| Cartap (Ref: TL 1258) |
(Also known as: C 11080; T 1258; thiobel) |
| Cartap is a largely obsolete insecticide. It is highly soluble in water, has a low volatility and tends not to persist in soil systems. There are data gaps regarding its human health effects but is known to be moderately toxic. There are also data gaps regarding its ecotoxicity but is highly toxic to aquatic vertebrates and moderately toxic to fish. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
|
A nereistoxin analogue insecticide used to control chewing and sucking pests usually used as the hydrochloride salt |
|
|
Aphids; Spidermites; Thrips; Whiteflies; Jassids |
|
|
Soya beans; Peanuts; Sunflowers; Maize; Sugarbeet; Wheat; Pearl barley; Fruit including apples, pears, plums, apricots, cherries, citrus; Vines; Chestnuts; Tea; Cotton; Sugarcane |
|
|
Cartap was reasonably effective at controlling chewing and sucking insect pests but more effective and less toxic pesticides may now be available. |
|
|
Voluntarily withdrawn |
|
|
1967, Japan |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₇H₁₅N₃O₂S₂ |
|
|
CN(C)C(CSC(=O)N)CSC(=O)N |
|
|
- |
|
|
IRUJZVNXZWPBMU-UHFFFAOYSA-N |
|
|
InChI=1S/C7H15N3O2S2/c1-10(2)5(3-13-6(8)11)4-14-7(9)12/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| cartap hydrochloride |
Variant |
 |
|
|
Insecticide |
|
|
Carbamate insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Phytotoxic. Nicotinic acetylcholine receptor (nAChR) channel blocker. |
|
|
22042-59-7 |
|
|
15263-53-3 |
|
|
239-309-2 |
|
|
387 |
|
|
Not listed |
|
|
27159 |
|
|
616-017-00-7 |
|
|
273.80 |
|
|
S,S'-[2-(dimethylamino)propane-1,3-diyl] dicarbamothioate |
|
|
S,S'-(2-dimethylaminotrimethylene) bis(thiocarbamate) |
|
|
S,S'-(2-(dimethylamino)-1,3-propanediyl) dicarbamothioate |
|
|
Marine Pollutant; Chemical subject to PIC regulations |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
14 |
|
|
Not applicable |
|
|
Leptinotarsa decemlineata, Plutella xylostella, Tuta absoluta, Meligethes aeneus |
|
|
Colourless to brown crystalline solid |
|
|
|
|
|
|
|
|
- FCC
- Kingtai Chemicals
- United Phosphorus
- BOC Sciences
|
|
|
- Padan
- Patap
- Sanvex
- Thiobel
- Fortap
- Forwatap
|
|
|
Usually supplied as dusts, granules and water-soluble powders |
|
|
|
|
|
|
|
200000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
187.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.12 X 10-01 |
Calculated |
- |
|
|
-0.95 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
1.00 X 10-10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
2.5 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Apple fruit, n=1 |
|
|
|
2.4 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.0-2.8 days, 2 field crops, various matrices, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
325 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
|
|
10 |
Z2 Z = Kingtai Chemials website (click here ) 2 = Unverified data of unknown source Rat 2 year |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1.0 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Moderately toxic to bees |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
> 1.98 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris 72 hr as hydrochloride |
Moderate |
| Data range 1.98-2.44 µg bee⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.6 |
Z2 Z = Kingtai Chemials website (click here ) 2 = Unverified data of unknown source Cyprinidae |
Moderate |
|
|
0.02 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Salmo trutta |
Moderate |
|
|
0.01 |
Daphnia magna |
High |
|
|
0.002 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Daphnia magna 48 hour |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
325 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
|
> 0.54 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Moderately toxic |
|
|
|
|
|
IMDG Transport Hazard Class 6,1 |
|
|
Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2757 |
|
|
- |
|
|
Limited shelf-life |
|
|
|
|
|
cartap |
|
|
cartap |
|
|
Cartap |
|
|
cartap |
|
|
cartap |
|
|
cartap |
|
|
cartap |
|
|
kartap |
|
|
- |
|
|
- |
|
|
cartap |
|
|
- |