| Cartap hydrochloride |
(Not known by any other names) |
| Cartap is a largely obsolete insecticide. It is highly soluble in water, has a low volatility and tends not to persist in soil systems. There are data gaps regarding its human health effects but is known to be moderately toxic. There are also data gaps regarding its ecotoxicity but is highly toxic to aquatic vertebrates and moderately toxic to fish. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
|
A nereistoxin analogue insecticide used to control chewing and sucking pests |
|
|
Aphids; Spidermites; Thrips; Whiteflies; Jassids |
|
|
Soya beans; Peanuts; Sunflowers; Maize; Sugarbeet; Wheat; Pearl barley; Fruit including apples, pears, plums, apricots, cherries, citrus; Vines; Chestnuts; Tea; Cotton; Sugarcane |
|
|
Cartap was reasonably effective at controlling chewing and sucking insect pests but more effective and less toxic pesticides may now be available. |
|
|
Considered obsolete but may be available in some countries |
|
|
1967, Japan |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₇H₁₆ClN₃O₂S₂ |
|
|
CN(C)C(CSC(=O)N)CSC(=O)N.Cl |
|
|
- |
|
|
MSHXTAQSSIEBQS-UHFFFAOYSA-N |
|
|
InChI=1S/C7H15N3O2S2.ClH/c1-10(2)5(3-13-6(8)11)4-14-7(9)12;/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12);1H |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| cartap hydrochloride |
- |
 |
|
|
Insecticide |
|
|
Carbamate insecticide; Nereistoxin analog insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Phytotoxic. Nicotinic acetylcholine receptor (nAChR) channel blocker. |
|
|
15263-52-2 |
|
|
239-309-2 |
|
|
387 |
|
|
- |
|
|
Not listed |
|
|
616-017-00-7 |
|
|
273.79 |
|
|
S-(3-carbamoylsulfanyl-2-(dimethylamino)propyl) carbamothioate;hydrochloride |
|
|
S-(3-carbamoylsulfanyl-2-(dimethylamino)propyl) carbamothioate;hydrochloride |
|
|
- |
|
|
Marine Pollutant; Chemical subject to PIC regulations |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
14 |
|
|
Not applicable |
|
|
Leptinotarsa decemlineata, Plutella xylostella, Tuta absoluta, Meligethes aeneus |
|
|
Colourless crystalline solid |
|
|
|
|
|
|
|
|
- FCC
- Kingtai Chemicals
- United Phosphorus
|
|
|
- Padan
- Patap
- Sanvex
- Thiobel
- Fortap
- Forwatap
|
|
|
Usually supplied as dusts, granules and water-soluble powders |
|
|
|
|
|
|
|
200000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
180 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.12 X 10-01 |
Calculated |
- |
|
|
-0.95 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
1.00 X 10-10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
2.5 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Apple fruit field study, n=1; RL₅₀ 12 days on cabbage leaves in lab study. |
|
|
|
2.4 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.0-2.8 days, 2 field crops, various matrices, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
250 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
Moderate |
|
|
|
10 |
Z2 Z = Kingtai Chemials website (click here ) 2 = Unverified data of unknown source Rat 2 year |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
10 |
Z2 Z = Kingtai Chemials website (click here ) 2 = Unverified data of unknown source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
> 1.98 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris 72 hr as hydrochloride |
Moderate |
| Data range 1.98-2.44 µg bee⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.6 |
Z2 Z = Kingtai Chemials website (click here ) 2 = Unverified data of unknown source Cyprinidae |
Moderate |
|
|
0.02 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Salmo trutta |
Moderate |
|
|
0.01 |
Daphnia magna |
High |
|
|
0.002 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Daphnia magna 48 hour |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
250 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
Moderate |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
|
> 0.54 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Moderately toxic |
|
|
|
|
|
IMDG Transport Hazard Class 6,1 |
|
|
Health: H302, H312 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
cartap hydrochloride |
|
|
cartap |
|
|
Cartap |
|
|
cartap |
|
|
cartap |
|
|
cartap |
|
|
cartap |
|
|
kartap |
|
|
- |
|
|
- |
|
|
cartap |
|
|
- |