| Carbendazim-sulfite |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health High alert: Reproduction/development effects
 |
|
|
A fungicide used to control a a range of diseases including Septoria, Fusarium and Sclerotina. Can also be a pesticide transformation product |
|
|
Husk spot; Chocolate spot; Grey mould; Green mould; Crown rot |
|
|
Beans; Macademia nuts; Lentils; Chickpeas; Strawberries; Sugarcane; Cereals |
|
|
Wheat/Fungal infections=Low |
|
|
Current |
|
|
1973, first reported; 1974, first introduced |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Germany |
|
|
Expired |
|
|
Not applicable |
|
|
Yes (as the acid) |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₉H₁₁N₃O₅S |
|
|
- |
|
|
- |
|
|
DHQNUCYHVRHSLC-UHFFFAOYSA-N |
|
|
InChI=1S/C9H9N3O2.H2O3S/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8;1-4(2)3/h2-5H,1H3,(H2,10,11,12,13);(H2,1,2,3) |
|
|
Yes |
|
|
Fungicide, Metabolite |
|
|
Soil |
|
|
Benzimidazole fungicide; Carbamate fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with curative and protectant activity. Inhibition of mitosis and cell division (Beta-tubulin assembly in mitosis). |
|
|
- |
|
|
No data found |
|
|
263 |
|
|
- |
|
|
- |
|
|
613-048-00-8 |
|
|
273.27 |
|
|
2-(methoxyformamido)-1H-3,1-benzimidazol-3-ium hydrogen sulfite |
|
|
2-(methoxycarbonylamino)-1H-3,1-benzimidazol-3-ium hydrogen sulfite |
|
|
2-[(methoxycarbonyl)amino]-1H-3,1-benzimidazolium sulfite (1:1) |
|
|
Marine Pollutant |
|
|
Environment Agency UK non-statutory standard for the protection of aquatic life: freshwater and saltwater annual average 0.1 µg l⁻¹; max acceptable conc: 1.0 µg l⁻¹ |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
1 |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
- AgriGuard
- DuPont
- Nufarm
- Barclay
|
|
|
- Delsene 50 Flo
- Harvesan
- Mascot
- Occidor
- Ringer
- Punch SE
|
|
|
Usually supplied as a soluble concentrate that is mixed with water and applied as a spray, used as a drench or pre-planting dip |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Negligible risk to consumers and bystanders |
|
|
Low risk to agricultural workers |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A2 A = Chromosome aberration (EFSA database) 2 = Mixed/ambiguous results ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Evidence of liver enzyme induction Possible liver toxicant Increase of estrogen production and aromatase activity |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 Not expected to autoignite; Not highly flammable |
|
|
Health: H340, H360fd Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN2757 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
carbendazim-sulfite |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |