| Bromobutide (Ref: S 4347 ) |
(Also known as: S-47) |
| Bromobutide is a post-emergence herbicide mainly used in Japan, It has a low aqueous solubility and is a moderately volatile substance. It may be prone to drift. Little information is available regarding its environmental fate. It is moderately toxic to fish. It has a low mammalian toxicity via the human route but other human health information is scant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Low alert
 Warning: Significant data are missing |
|
|
A selective, post emeregnce herbicide that is currently used to control perennial weeds in paddy fields |
|
|
Cockspur (Echinochloa oryzicola); False pickerelweed (Monochoria vaginals); Rotala indica; Scirpus juncoides |
|
|
Paddy rice |
|
|
- |
|
|
Current |
|
|
1981, first reported |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
|
C₁₅H₂₂BrNO |
|
|
CC(C)(C)C(C(=O)NC(C)(C)C1=CC=CC=C1)Br |
|
|
- |
|
|
WZDDLAZXUYIVMU-UHFFFAOYSA-N |
|
|
InChI=1S/C15H22BrNO/c1-14(2,3)12(16)13(18)17-15(4,5)11-9-7-6-8-10-11/h6-10,12H,1-5H3,(H,17,18) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| bromobutide |
- |
 |
|
|
Herbicide |
|
|
Amide herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibition of 4-hydroxyphenyl-pyruvate dioxygenase, bleaching |
|
|
74712-19-9 |
|
|
No data found |
|
|
None allocated |
|
|
Not listed |
|
|
53079 |
|
|
No data found |
|
|
312.25 |
|
|
rac-(2R)-2-bromo-3,3-dimethyl-N-(2-phenylpropan-2-yl)butanamide |
|
|
(RS)-2-bromo-3,3-dimethyl-N-(1-methyl-1-phenylethyl)butyramide |
|
|
2-bromo-3,3-dimethyl-N-(1-methyl-1-phenylethyl)butanamide |
|
|
May be prone to drift. |
|
|
- |
|
|
Z |
|
|
0 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless to yellow crystals |
|
|
|
|
|
|
|
3.54 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source at 25 °C |
Low |
|
|
4700 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Xylene |
- |
| 35000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Methanol |
- |
| 500 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Hexane |
- |
|
|
-112 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
101.4 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
23 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source (closed cup) |
- |
|
|
|
3.02 X 1003 |
Calculated |
- |
|
|
3.48 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.276 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
74.0 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Highly volatile |
|
|
6.53 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 10.0 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Cyprinus carpio |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause damage to lungs and mucous membranes |
|
|
|
|
|
Flammable |
|
|
- |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN1126 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
bromobutide |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |