| Bromacil (Ref: DPX N0976) |
(Also known as: borocil; herbicide 976) |
| Bromacil is a soil acting uracil herbicide which is is used to control both annual and perennial weeds, although some essential uses may be authorised. It is highly solublein water and many organic solvents. It is not considered volatile. It may be persistent in soil and water systems depending on local conditions. Theres is also concerns regarding its potenrial to leach to groundwater. It tends to demonstrate a low to moderate toxicity to most fauna and flora. Iit has a moderate mammalian oral toxicity and no other serious human health concerns have been identified. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen; Possible Endocrine distrupter
 |
|
|
A soil acting uracil herbicide used to control a wide variety of annual and perennial weeds mainly on non-crop areas and fruit |
|
|
Barnyardgrass; Crabgrass; Henbit; Lambsquarters; Purslane; Annual sedge; Mustard; Bermudagrass; Nutsedge |
|
|
Fruit including citrus, pineapples; Brush; Roads, rights-of-way, railways, pavements |
|
|
- |
|
|
Current |
|
|
1961, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule existing in the R- and S-forms. This substance is a mixture of both forms. |
|
|
C₉H₁₃BrN₂O₂ |
|
|
CCC(C)N1C(=O)C(=C(NC1=O)C)Br |
|
|
No data |
|
|
CTSLUCNDVMMDHG-UHFFFAOYSA-N |
|
|
InChI=1S/C9H13BrN2O2/c1-4-5(2)12-8(13)7(10)6(3)11-9(12)14/h5H,4H2,1-3H3,(H,11,14) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| bromacil |
Unstated isomer |
 |
|
|
Herbicide |
|
|
Uracil herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Absorbed mainly via root system, non-selective. Inhibits photosynthesis (photosystem II). |
|
|
314-40-9 |
|
|
206-245-1 |
|
|
139 |
|
|
012301 |
|
|
9411 |
|
|
No data found |
|
|
261.12 |
|
|
rac-(3R)-5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione |
|
|
(RS)-5-bromo-3-sec-butyl-6-methyluracil |
|
|
5-bromo-6-methyl-3-(1-methylpropyl)-2,4(1H,3H)-pyrimidinedione |
|
|
Potential groundwater contaminant; Potential marine pollutant; PAN Bad Actor Chemical |
|
|
- |
|
|
C1 |
|
|
5 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystals |
|
|
|
|
|
|
|
|
- Nufarm
- DuPont
- Loveland
- Makhteshim-Agan
|
|
|
- Hyvar X bromoacil
- Borocil 1V
- Cynogan
- Borea
- Krovar II
- Urgan
|
|
|
Available in a variety of formulations including wettable powders, water soluble liquids and granules. |
|
|
|
|
|
|
|
815 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
167000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
| 134000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Ethanol |
- |
| 32000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Xylene |
- |
|
|
158.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
158 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
7.59 X 1001 |
Calculated |
- |
|
|
1.88 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.59 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
9.27 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
- |
| Very weak acid |
|
|
4.10 X 10-02 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
1.50 X 10-05 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
60 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ 5-6 months in silt loam soil (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Stable |
|
|
Stable at pH 5 and pH 7 |
|
|
|
Stable |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Stable |
|
|
Stable at all relevant pHs |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Mobile |
|
|
32 |
|
|
Other sources: log Koc 1.51 (Q3); General literature: Koc 2.3 to 289 (CA3) |
|
|
|
2.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
|
117 |
|
|
0.917 |
|
|
Data for freshwater sediments Kf range 0.56-6.35 mL.g, Kfoc range 26.3-289 mL g⁻¹, 1/n range 0.89-0.98, Soils = 9 |
|
|
- |
|
|
|
|
|
|
|
3.44 |
Calculated |
High leachability |
|
|
|
5.51 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
2.8 |
Whole fish |
Low potential |
|
|
Not available |
- |
|
|
|
|
|
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1300 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
50 |
- |
|
|
- |
- |
- |
|
|
> 2250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmless at dose 960 g ha⁻¹ |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmless at dose 960 g ha⁻¹ |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
|
> 95.6 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Pimephales promelas |
Low |
|
|
> 119 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
> 67.0 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.013 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Unknown species |
Moderate |
|
|
0.01 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Green algae population study |
Moderate |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1300 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
5.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Excreted primarily in the urine |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause inflammation of the stomach and intestinal mucous membranes, gastroenteritis or liver damage |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
Health: H302, H315, H319, H335 Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
bromacil |
|
|
bromacil |
|
|
Bromacil |
|
|
bromacil |
|
|
bromacile |
|
|
bromacilo |
|
|
- |
|
|
bromacyl |
|
|
- |
|
|
- |
|
|
- |
|
|
- |