| Bromacil-dimethylammonium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health Moderate alert: Possible Carcinogen; Possible Endocrine distrupter
 |
|
|
A soil acting uracil herbicide used to control a wide variety of annual and perennial weeds mainly on non-crop areas and fruit |
|
|
Barnyardgrass; Crabgrass; Henbit; Lambsquarters; Purslane; Annual sedge; Mustard; Bermudagrass; Nutsedge |
|
|
Fruit including citrus, pineapples; Brush; Roads, rights-of-way, railways, pavements |
|
|
- |
|
|
Current |
|
|
1961, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes (as bromacil) |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule existing in the R- and S-forms. This substance is a mixture of both forms. |
|
|
C₁₁H₂₀BrN₃O₂ |
|
|
CCC(C)N1C(=O)C(=C(NC1=O)C)Br.CNC |
|
|
- |
|
|
VWQXSGUWVIZRBK-UHFFFAOYSA-N |
|
|
InChI=1S/C9H13BrN2O2.C2H7N/c1-4-5(2)12-8(13)7(10)6(3)11-9(12)14;1-3-2/h5H,4H2,1-3H3,(H,11,14);3H,1-2H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| Bromacil |
Parent |
 |
|
|
Herbicide |
|
|
Uracil herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Absorbed mainly via root system, non-selective. Inhibits photosynthesis (photosystem II). |
|
|
69484-13-5 |
|
|
No data found |
|
|
139 |
|
|
- |
|
|
86278206 |
|
|
No data found |
|
|
306.20 |
|
|
5-bromo-3-butan-2-yl-6-methyl-1H-pyrimidine-2,4-dione;N-methylmethanamine |
|
|
5-bromo-3-butan-2-yl-6-methyl-1H-pyrimidine-2,4-dione;N-methylmethanamine |
|
|
- |
|
|
Potential groundwater contaminant; Potential marine pollutant; PAN Bad Actor Chemical |
|
|
- |
|
|
C1 |
|
|
5 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
- |
|
|
- |
|
|
Available in a variety of formulations including wettable powders, water soluble liquids and granules. |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause inflammation of the stomach and intestinal mucous membranes, gastroenteritis or liver damage |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
Health: H302, H315, H319, H335 Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
bromacil-dimethylammonium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |