| Bioresmethrin (Ref: FMC 17370) |
(Also known as: bioresmethrine; NRDC107; biobenzylfuraline; benzofuroline) |
| Bioresmethrin is a broad spectrum pyrethroid insecticide. It hasd a low aqueous solubility and is moderately volatile. It is not thought to be environmentally persistent and, based on its physicochemical properties, would not be expected to leach to groundwater. Bioresmethrin is highly toxic to fish, aquatic invertebrates and honey bees. It as a low mammalian oral toxicity but may be a respiratory irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High; Bees acute oral ecotoxicity: High
 |
Human health Moderate alert: Possible Endocrine distrupter
 |
|
|
A broad-spectrum pyrethroid ester insecticide used mainly in domestic and public health situations |
|
|
Houseflies; Hornets; Wasps; Mosquitoes; Cockroaches; Mites |
|
|
Houses; Industrial premises; Public health situations; Food storage |
|
|
- |
|
|
Current |
|
|
circa 1968 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
This is one of four optical isomers of resmethrin and the most biologically active. |
|
|
C₂₂H₂₆O₃ |
|
|
CC(=CC1C(C1(C)C)C(=O)OCC2=COC(=C2)CC3=CC=CC=C3)C |
|
|
CC(=C[C@@H]1[C@H](C1(C)C)C(=O)OCC2=COC(=C2)CC3=CC=CC=C3)C |
|
|
VEMKTZHHVJILDY-UXHICEINSA-N |
|
|
InChI=1S/C22H26O3/c1-15(2)10-19-20(22(19,3)4)21(23)25-14-17-12-18(24-13-17)11-16-8-6-5-7-9-16/h5-10,12-13,19-20H,11,14H2,1-4H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| bioresmethrin |
- |
 |
|
|
Insecticide |
|
|
Pyrethroid ester insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Contact action acting on the insects nervous system. Sodium channel modulator. |
|
|
28434-01-7 |
|
|
249-014-0 |
|
|
222 |
|
|
97801 |
|
|
162381 |
|
|
613-120-00-9 |
|
|
338.44 |
|
|
(5-benzylfuran-3-yl)methyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
|
|
5-benzyl-3-furylmethyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
|
|
[5-(phenylmethyl)-3-furanyl]methyl (1R,3R)-2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate |
|
|
PAN Listed as Highly Hazardous Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
3A |
|
|
Not applicable |
|
|
Aedes aegypti, Oryzaephilus surinamensis, Rhizopertha dominica, Tribolium castaneum |
|
|
Viscous yellow brown liquid |
|
|
|
|
|
|
|
|
- Bonide Products
- Scotts Company
- Bayer Environmental
|
|
|
- Pynosect
- Pyretherm
- Synthrin
|
|
|
- |
|
|
|
|
|
|
|
0.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
180 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
92 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
5.01 X 1004 |
Calculated |
- |
|
|
4.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
18.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
|
0.563 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
3 |
S1 S = Expert judgement 1 = Estimated data with little or no verification |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Degraded by UV light |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Rapidly hydrolyses under alkaline conditions |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
S1 S = Expert judgement 1 = Estimated data with little or no verification |
Slightly mobile |
|
|
2255 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.31 |
Calculated |
Low leachability |
|
|
|
1.24 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
3000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 7070 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
1200 |
- |
|
|
- |
- |
- |
|
|
> 10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Gallus domesticus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.019 |
Apis mellifera |
High |
|
|
> 0.002 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.00062 |
Oncorhynchus mykiss |
High |
|
|
- |
- |
- |
|
|
0.0008 |
Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 7070 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
5.28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.03 |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Although of a low toxicity bioresmethrin is rapidly absorbed from the intestinal tract and moved around body |
|
|
|
|
|
No information available |
|
|
Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
bioresmethrin |
|
|
bioresmethrine |
|
|
Bioresmethrin |
|
|
bioresmethrin |
|
|
bioresmetrin |
|
|
bioresmetrin |
|
|
bioresmethrin |
|
|
bioresmetryna |
|
|
bioresmetrin |
|
|
- |
|
|
bioresmetrine |
|
|
- |