| Bioallethrin |
(Also known as: allethrin; esbiol; esdeballethrin; esbiothrin) |
| Bioallethrin is an insecticide. It has a low aqueous solubility, is volatile and would not normally be expected to leach to groundwater. It is moderately persistent in soil and, under certain conditions, could be persistent in water. It is moderately toxic to mammals, is an endocrine distrupter and an eye irritant. Bioallethrin is highly toxic to fish but less so to birds and honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Endocrine distrupter
 |
|
|
A pyrethroid ester insecticide used mainly in domestic situations |
|
|
House flies; Mosquitoes; Wasps; Hornets; Cockroaches |
|
|
Houses; Officies and industrial sites |
|
|
- |
|
|
Current |
|
|
1969 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A mixture of two allethrin stereoisomers (1R,trans;1R and 1R,trans;1S) in an approximate ratio of 1:1, where both isomers are active ingredients |
|
|
C₁₉H₂₆O₃ |
|
|
CC1=C(C(=O)CC1OC(=O)C2C(C2(C)C)C=C(C)C)CC=C |
|
|
- |
|
|
ZCVAOQKBXKSDMS-AQYZNVCMSA-N |
|
|
InChI=1S/C19H26O3/c1-7-8-13-12(4)16(10-15(13)20)22-18(21)17-14(9-11(2)3)19(17,5)6/h7,9,14,16-17H,1,8,10H2,2-6H3 |
|
|
Yes |
|
|
Insecticide |
|
|
Pyrethroid ester insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic, contact and stomach action with a rapid knock-down effect. Sodium channel modulator. |
|
|
260359-57-7 |
|
|
249-013-5 |
|
|
203 |
|
|
004003 |
|
|
11442 |
|
|
006-025-00-3 |
|
|
302.41 |
|
|
(1E)-2-methyl-4-oxo-3-(prop-2-en-1-yl)cyclopent-2-en-1-yl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
|
|
(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R)-trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
|
|
2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl (1R,3R)-2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
3A |
|
|
Not applicable |
|
|
- |
|
|
Orange viscous liquid |
|
|
|
|
|
|
|
|
- Scotts
- Farnam Co
- Sumitomo Chemical Co. Ltd.
|
|
|
|
|
|
The usual formulations include aerosols and sprays, usually with synergists. |
|
|
|
|
|
|
|
4.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
Not applicable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
168 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
87 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
|
4.79 X 1004 |
Calculated |
- |
|
|
4.68 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
43.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
|
2.89 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
32 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Degraded by UV light |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
Stable at pH 5 to pH 7: DT₅₀ 4.3 days at pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
V1 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 1 = Estimated data with little or no verification |
Non-mobile |
|
|
9500 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.03 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
1897 |
Estimated |
Threshold for concern |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
709 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
750 |
- |
|
|
- |
- |
- |
|
|
> 2030 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
3.4 |
Apis mellifera |
Moderate |
|
|
6.85 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.024 |
Lepomis macrochirus |
High |
|
|
- |
- |
- |
|
|
0.0356 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
709 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
3000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
2.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause lung congestion USEPA - some evidence to suggest possible human carcinogen Endocrine issues - Inhibition of estrogen-sensitive cells proliferation |
|
|
|
|
|
No information available |
|
|
Health: H302, H332 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
bioallethrin |
|
|
bioallethrine |
|
|
Bioallethrin |
|
|
bioallethrin |
|
|
bioalletrin |
|
|
bioalletrin; bioaletrina |
|
|
bioallethrin |
|
|
bioaletryna |
|
|
bioalletrin |
|
|
- |
|
|
bioallethrin |
|
|
- |