| Bicyclopyrone (Ref: NOA449280) |
(Not known by any other names) |
| Bicyclopyrone is a broad spectrum herbicide. It is highly soluble in water and non-volatile. It can be persistent in both soil and aquatic systems. It is moderately toxic to fish, aquatic invertebrates and aquatic plants but presents a low risk to honey bees. Its oral mammalian toxicity is low but there are some concerns that it may be a reproduction/developmental toxin. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Mammals chronic toxicity: High; Reproduction/development effects
 |
|
|
A broad-spectrum herbicide, sometimes used in mixtures, for the pre- and post-emergence control of grass and dicot weeds mainly in corn |
|
|
Foxtail; Wild buckwheat; Common ragweed |
|
|
Field corn; Seed corn; Sweetcorn; Popcorn; Silage corn; Sugarcane; Cereals including wheat and barley |
|
|
- |
|
|
Current |
|
|
2014, first registered USA |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Substance is racemic. |
|
|
C₁₉H₂₀F₃NO₅ |
|
|
COCCOCC1=C(C=CC(=N1)C(F)(F)F)C(=C2C(=O)C3CCC(C3)C2=O)O |
|
|
COCCOCC1=C(C=CC(=N1)C(F)(F)F)C(=C2C(=O)[C@@H]3CC[C@@H](C3)C2=O)O |
|
|
AIAYSXFWIUNXRC-PHIMTYICSA-N |
|
|
InChI=1S/C19H20F3NO5/c1-27-6-7-28-9-13-12(4-5-14(23-13)19(20,21)22)18(26)15-16(24)10-2-3-11(8-10)17(15)25/h4-5,10-11,24H,2-3,6-9H2,1H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Triketone herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Hydroxyphenylpyruvate dioxygenase (HPPD) inhibitor - causes plant bleaching |
|
|
352010-68-5 |
|
|
365400-11-9 |
|
|
688-487-1 |
|
|
None allocated |
|
|
018986 |
|
|
11188745 |
|
|
No data found |
|
|
399.36 |
|
|
rac-(1R,5R)-4-hydroxy-3-{2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)pyridine-3-carbonyl}bicyclo[3.2.1]oct-3-en-2-one |
|
|
4-hydroxy-3-{2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)-3-pyridylcarbonyl}bicyclo[3.2.1]oct-3-en-2-one |
|
|
4-hydroxy-3-[[2-[(2-methoxyethoxy)methyl]-6-(trifluoromethyl)-3-pyridinyl]carbonyl]bicyclo[3.2.1]oct-3-en-2-one |
|
|
Possible groundwater contaminant |
|
|
- |
|
|
F2 |
|
|
27 |
|
|
Not applicable |
|
|
Not applicable |
|
|
None identified |
|
|
White powdery solid |
|
|
|
|
|
|
|
1200 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
High |
|
|
500000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Acetone |
- |
| 500000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Ethyl acetate |
- |
| 91000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Toluene |
- |
| 8999 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Hexane |
- |
|
|
65.3 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
|
489.5 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
249.9 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
|
6.31 X 10-02 |
Calculated |
- |
|
|
-1.2 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.503 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
|
3.06 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
| - |
|
|
5.0 X 10-03 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low volatility |
|
|
1.7 X 10-08 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
213.2 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
43 |
|
Stable |
|
|
DT₅₀ given as between 11 and 75 days |
|
|
|
Stable |
|
Stable |
|
|
Stable at all relevant pH values |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
|
|
|
|
Major fraction |
- |
- |
|
|
Major fraction |
- |
- |
|
|
Major fraction |
- |
- |
|
|
Major fraction |
- |
- |
|
|
Major fraction |
- |
- |
|
|
Major fraction |
- |
- |
|
|
Major fraction |
- |
- |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
| 6-(trifluoromethyl)pyridine-2,3-dicarboxylic acid (Ref: SYN 504810) |
CSCC 163768 |
Water |
- |
- |
| Ref: SYN 545859 |
CSCD 642512 |
Water |
- |
- |
| 6-(trifluoromethyl)pyridin-3-ol-2-carboxylic acid (Ref: SYN 545680) |
CSCD 656832 |
Water |
- |
- |
| 2-(2-methoxy-ethoxymethyl)-6-trifluoromethyl-nicotinic acid |
SYN 503780 |
Water |
- |
- |
| - |
CSAA 806573 |
Water |
- |
- |
| Ref: SYN 503780 |
CSAA 794148 |
Water |
- |
- |
| 4-hydroxy-3-(2-(2-methoxy-ethoxymethyl)-6-(trifluoromethyl)-pyridine-3-carbonyl]-bicyclo [3.2.1]oct-3-en-2-one |
NOA 449280 |
Water |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
0.72 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
780.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
784.4 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
46.9 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
46.7 |
E4 E = Manufacturers safety data sheets 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.013 |
E4 E = Manufacturers safety data sheets 4 = Verified data Lemna gibba |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
5000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
- |
|
|
> 5.2 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.01 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rabbit US data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
bicyclopyrone |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |