| Beta-endosulfan |
(Also known as: endosulfan II; alpha-thionex; beta-thiodan; endosulfan 2) |
| Beta-endosulfan is an insecticide used to control sucking, chewing and boring insects in a variety of crops. Little is known about this particular isomers environmental fate, ecotoxicology or impact on human health or how these differs from endosulfan. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health High alert: Endocrine distrupter
 |
|
|
An insecticide and acaricide used to control sucking, chewing and boring insects |
|
|
Mites; Ticks; Tstetse fly; Colorado beetle; Aphids; White flies; Leaf hoppers |
|
|
Cotton; Potatoes; Tomatoes; Apples |
|
|
- |
|
|
- |
|
|
circa 1956 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes (as racemate) |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Endosulfan has isomers, endo and exo which are also known as endosulfan I and II or alpha and beta endosulfan |
|
|
C₉H₆Cl₆O₃S |
|
|
C1C2C(COS(=O)O1)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
|
|
C1[C@@H]2[C@H](COS(=O)O1)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
|
|
RDYMFSUJUZBWLH-MDBBVBRHSA-N |
|
|
InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2/t3-,4+,7-,8+,19? |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| beta-endosulfan |
- |
 |
| endosulfan |
Unstated isomer |
 |
|
|
Insecticide, Acaricide |
|
|
Organochloride insecticide; Organochloride acaricide; Cyclodiene insecticide; Cyclodiene acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic with contact and stomach action, acts as a non-competitive GABA antagonist |
|
|
33213-65-9 |
|
|
625-635-6 |
|
|
89 |
|
|
079403 |
|
|
12309467 |
|
|
602-052-00-5 |
|
|
406.93 |
|
|
- |
|
|
6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3α,5aα,6β,9β,9aα)-6,9-Methano-2,4,3-benzodioxathiepin |
|
|
3α,5aβ,6β,9β,9aβ-6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-oxideβ-Endosulfan |
|
|
PAN Bad Actor Chemical; POP candidate; OSPAR pfa/soc; WFD priority substance; Chemical subject to PIC regulations |
|
|
EU Directive 2008/105/EC EQS surface waters: annual average 0.005 µg l⁻¹; max measured 0.01 µg l⁻¹ |
|
|
Not applicable |
|
|
Not applicable |
|
|
2A |
|
|
Not applicable |
|
|
None identified |
|
|
- |
|
|
|
|
|
|
|
|
|
|
0.45 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
208 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
6.76 X 1003 |
Calculated |
- |
|
|
3.83 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
2.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.28-3.35 days, 4 field crops, fruit & leaves, n=7 |
|
|
|
1.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.9-2.6 days, 2 field crops, foliage, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
240 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
3.24 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Chironomus dilutus as 10d LC₅₀ |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
240 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I |
- |
- |
|
|
|
- |
|
|
Can be absorbed following ingestion, inhalation and skin contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Highly toxic May cause headache, dizziness, nausea, vomiting, incoordination, tremor, mental confusion, hyperexcitable state |
|
|
|
|
|
Incompatible with strong oxidising and reducing agents May decompose upon heating to produce corrosive and/or toxic fumes IMDG Transport Hazard Class 6.1 |
|
|
- |
|
|
- |
|
|
UN2811 |
|
|
Packaging Group II (moderate danger) |
|
|
Chemically stable under standard ambient conditions |
|
|
|
|
|
beta-endosulfan |
|
|
betaendosulfan |
|
|
beta-Endosulfan |
|
|
beta-endosulfan |
|
|
betaendosulfan |
|
|
betaendosulfan |
|
|
beta endosulphan |
|
|
beta-endosulfan |
|
|
- |
|
|
beta endoszulfan |
|
|
beta-endosulfan |
|
|
- |