| Benzofenap (Ref: MY 71) |
(Also known as: Yukawide) |
| Brnzofenap is a herbicide used mainly to control broad-leaved weeds in water-seeded rice. It has a low aqueous solubility, is not volatile and is moderately persistent in soil systems with a low risk of leaching to groundwater. Benzofenap tends to have a low to moderate toxicity to biodiversity. Its toxicity to mammals including humans is low if ingested. It is also a skin irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
Used mainly to control broad-leaved weeds in water-seeded rice |
|
|
Seedings of water plantain (Sagittaria montevidensis), Maddog weed (Alisma plantago aquatica), Lance-leaf water plantain (Alisma lanceolatum), Starfruit plantain (Damasonium minus), Flatsedge (Cyperus difformis) |
|
|
Paddy rice |
|
|
- |
|
|
Current |
|
|
1981, first synthesized; 1987, first registered Japan |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₂₂H₂₀Cl₂N₂O₃ |
|
|
CC1=CC=C(C=C1)C(=O)COC2=C(C(=NN2C)C)C(=O)C3=C(C(=C(C=C3)Cl)C)Cl |
|
|
No data |
|
|
JDWQITFHZOBBFE-UHFFFAOYSA-N |
|
|
InChI=1S/C22H20Cl2N2O3/c1-12-5-7-15(8-6-12)18(27)11-29-22-19(14(3)25-26(22)4)21(28)16-9-10-17(23)13(2)20(16)24/h5-10H,11H2,1-4H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Benzoylpyrazole herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic, absorbed through roots. Bleaching inhibition of 4-hydroxyphenyl-pyruvate-dioxygenase. |
|
|
82692-44-2 |
|
|
No data found |
|
|
None allocated |
|
|
Not listed |
|
|
94686 |
|
|
No data found |
|
|
431.31 |
|
|
2-{[4-(2,4-dichloro-3-methylbenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl]oxy}-1-(4-methylphenyl)ethan-1-one |
|
|
2-[4-(2,4-dichloro-m-toluoyl)-1,3-dimethylpyrazol-5-yloxy]-4'-methylacetophenone |
|
|
2-[[4-(2,4-dichloro-3-methylbenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl]oxy]-1-(4-methylphenyl)ethanone |
|
|
- |
|
|
- |
|
|
F2 |
|
|
27 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White solid |
|
|
|
|
|
- Bayer CropScience
- Rhone poulenc
|
|
|
|
|
|
Usually supplied as a flowable concentrate or as granules |
|
|
|
|
|
|
|
0.13 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low |
|
|
69000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 73000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 5600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
| 920000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
|
|
133.3 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.90 X 1004 |
Calculated |
- |
|
|
4.69 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.09 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.013 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
38 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Data for paddy fields |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-mobile |
|
|
6405 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.31 |
Calculated |
Low leachability |
|
|
|
7.73 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 15000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Coturnix japonica |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 0.762 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 0.383 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.148 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 15000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
5000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
1.93 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H332 Environment: H400, H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
benzofenap |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
benzofenap |
|
|
- |
|
|
- |
|
|
- |
|
|
- |