| Benzfendizone (Ref: F 3686) |
(Also known as: FMC 143686) |
| Benzfendizone is a herbicide used to control broad-leaved weeds and grasses. Little is known about the environmental fate or ecotoxicology of this obsolete pesticide. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Drainflow: Non-mobile
 Warning: Significant data are missing |
|
Human health Low alert
 Warning: Significant data are missing |
|
|
An obsolete post-emergence herbicide for the control of grass and broad-leaved weeds |
|
|
Potato desiccant; Cotton defoliant; Pigweed; Wild mustard; Velvetleaf; Foxtail; Johnssongrass |
|
|
Orchards; Soybean; Cotton; Potatoes |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1998 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule.Substance is racemic. |
|
|
C₂₅H₂₅F₃N₂O₆ |
|
|
CCC1=CC(=C(C=C1)COC2=CC=C(C=C2)N3C(=O)C=C(N(C3=O)C)C(F)(F)F)OC(C)C(=O)OC |
|
|
- |
|
|
LYPWWQLKWQNQKV-UHFFFAOYSA-N |
|
|
InChI=1S/C25H25F3N2O6/c1-5-16-6-7-17(20(12-16)36-15(2)23(32)34-4)14-35-19-10-8-18(9-11-19)30-22(31)13-21(25(26,27)28)29(3)24(30)33/h6-13,15H,5,14H2,1-4H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Dicarboximide herbicide; Phenyluracil herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibition of protoporphyrinogen oxidase |
|
|
158755-95-4 |
|
|
816-462-9 |
|
|
None allocated |
|
|
Not listed |
|
|
15457485 |
|
|
No data found |
|
|
506.47 |
|
|
rac-methyl (2R)-2-[2-({4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]phenoxy}methyl)-5-ethylphenoxy]propanoate |
|
|
methyl (RS)-2-(5-ethyl-2-{4-[1,2,3,6-tetrahydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxymethyl}phenoxy)propionate |
|
|
methyl 2-[2-[[4-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]phenoxy]methyl]-5-ethylphenoxy]propanoate |
|
|
- |
|
|
- |
|
|
E |
|
|
14 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
- Obsolete - not thought to be commercially available for crop protection applications
|
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
480 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Predicted |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.74 X 1004 |
Calculated |
- |
|
|
4.24 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Predicted |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.32 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-mobile |
|
|
4847 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Not classified: Obsolete |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
benzfendizone |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |