| Benzalkonium chloride |
(Also known as: zephiran chloride; benirol; alkyl dimethylbenzyl ammonium chloride) |
| Benzalkonium chloride is a multi-use biocide used mainly for cleaning hard surfaces. Data relating to its environmental fate and ecotoxicology is scant but it is moderately toxic to aquatic organisms. It is moderately toxic to humans if ingested and is a reproduction/developmental and neurological toxin. It is also a recognised irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Reproduction/development effects; Neurotoxicant
 |
|
|
A multi-use biocide used for cleaning and preparation of all types of hard surfaces |
|
|
Mould; Mildew; Mosses; Fungi; Algae |
|
|
Hard surfaces including walkways, pavements, patios |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A mixrture of at least three components - none of which are isomeric |
|
|
e.g. C₂₁H₃₈ClN |
|
|
CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] |
|
|
- |
|
|
- |
|
|
InChI=1S/C21H38N.ClH/c1-4-5-6-7-8-9-10-11-12-16-19-22(2,3)20-21-17-14-13-15-18-21;/h13-15,17-18H,4-12,16,19-20H2,1-3H3;1H/q+1;/p-1 |
|
|
Yes |
|
|
Biocide, Fungicide, Algicide |
|
|
Unclassified pesticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Rapid action, thought to effect the cytoplasmic membrane that controls cell permeability |
|
|
8001-54-5 |
|
|
264-151-6 |
|
|
None allocated |
|
|
069105 |
|
|
No data |
|
|
No data found |
|
|
e.g. 339.99 |
|
|
- |
|
|
mixture of alkylbenzyldimethylammonium chlorides |
|
|
quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yellowish-white powder |
|
|
|
|
|
|
|
|
- Obsolete - not thought to be commercially available for crop protection applications
|
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
10000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Ether |
- |
|
|
35 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.98 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
240 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.823 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.11 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.18 |
Chlorella pyrenoidosa |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
240 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
GB MRL expected to deviate from the EU MRL in mid-2023 |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Severe over-exposure can produce lung damage Kidneys, liver, heart, gastrointestinal tract toxicant |
|
|
|
|
|
Corrosive Hygroscopic |
|
|
- |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
benzalkonium chloride |
|
|
chlorure de benzalkonium |
|
|
- |
|
|
- |
|
|
- |
|
|
cloruro de benzalconio |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |