| Benthiavalicarb |
(Also known as: Acid benthiavalicarb) |
| Benthiavalicarb is a herbicide usually used as the isopropyl variant. It is not highly toxic to mammals or fauna and flora. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Carcinogen; Possible Reproduction/development effects
 |
|
|
A fungicide active against Oomycetes fungal plant pathogens usually used as the isopropyl variant |
|
|
Blight; Downy mildew |
|
|
Potatoes; Vines; Tomatoes; Grapes |
|
|
- |
|
|
Current |
|
|
2003 |
|
|
Approved |
|
|
31/07/2027 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Poland/France |
|
|
31/07/2023 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
|
✓ |
✓ |
|
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
|
✓ |
|
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
|
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
|
|
A chiral molecule |
|
|
C₁₅H₁₈FN₃O₃S |
|
|
CC(C)C(C(=O)NC(C)C1=NC2=C(S1)C=C(C=C2)F)NC(=O)O |
|
|
C[C@H](C1=NC2=C(S1)C=C(C=C2)F)NC(=O)[C@H](C(C)C)NC(=O)O |
|
|
VVSLYIKSEBPRSN-PRHODGIISA-N |
|
|
InChI=1S/C15H18FN3O3S/c1-7(2)12(19-15(21)22)13(20)17-8(3)14-18-10-5-4-9(16)6-11(10)23-14/h4-8,12,19H,1-3H3,(H,17,20)(H,21,22)/t8-,12+/m1/s1 |
|
|
Yes |
|
|
Fungicide |
|
|
Carbamate fungicide; Valinamide fungicide; Benzothiazole fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Protective and curative action with residual effects, inhibits phospholipid biosynthesis |
|
|
413615-35-7 |
|
|
609-913-4 |
|
|
744 |
|
|
Not listed |
|
|
20593234 |
|
|
No data found |
|
|
339.5 |
|
|
[(1S)-1-{[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamoyl}-2-methylpropyl]carbamic acid |
|
|
[(S)-1-{[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamoyl}-2-methylpropyl]carbamic acid |
|
|
[(1S)-1-[[[(1R)-1-(6-fluoro-2-benzothiazolyl)ethyl]amino]carbonyl]-2-methylpropyl]carbamic acid |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
40 |
|
|
- |
|
|
White powder |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Usually supplied as the isopropyl variant and formulated as water dispersible granules or flowable concentrates for use as a spray |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
0.3 |
as isopropyl variant |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
|
|
|
|
Major fraction |
0.268 |
Applied as the isopropyl varian |
|
|
Minor fraction |
0.098 |
Applied as the isopropyl varian |
|
|
Minor fraction |
0.026 |
Applied as the isopropyl varian |
|
|
Major fraction |
0.277 |
Applied as the isopropyl variant |
|
|
Major fraction |
0.123 |
Applied as the isopropyl varian |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
6-fluoro-2-hydroxybenzothiazole (Ref: KIF-230-M1) Note: Applied as the isopropyl variant |
KIF-230-M1 |
Rat; Plant; Surface water; Sediment |
- |
- |
1-(6-fluoro-2-benzothiazol-2-yl)ethanol (Ref: KIF 230-M3) Note: Applied as the isopropyl variant |
KIF-230-M3 |
Rat; Surface water; Sediment |
- |
- |
1-(6-fluoro-2-benzothiazolyl)ethylamine (Ref: KIF 230-M5) Note: Applied as the isopropyl variant |
KIF-230-M5 |
Rat; Surface water; Sediment |
- |
- |
- Note: Applied as the isopropyl variant |
KIF-230-M15 |
Rat |
- |
- |
6-fluorobenzothiazol-2-yl methyl ketone Note: Applied as the isopropyl variant |
KIF-230-M4 |
Plant; Surface water; Sediment |
- |
- |
N-[1-(6-Fluorobenzothiazol-2-yl)ethyl]acetamide Note: Applied as the isopropyl variant |
KIF-230-M8 |
Surface water; Sediment |
- |
- |
6,6’-difluoro-2,2’-dibenzothiazole Note: Applied as the isopropyl variant |
KF-230-I-6 |
Impurity |
- |
- |
bis(2-amino-5-fluorophenyl) disulphide Note: Applied as the isopropyl variant |
KF-230-I-12 |
Impurity |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Colinus virginianus as isopropyl variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
Eisenia foetida as isopropyl variant |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
|
Low |
|
|
> 100 |
as isopropyl variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 10 |
Oncorhynchus mykiss as isopropyl variant |
Moderate |
|
|
1.0 |
Oncorhynchus mykiss as isopropyl variant 28 day |
Moderate |
|
|
> 10 |
Daphnia magna as isopropyl variant |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 10 |
Pseudokirchneriella subcapitata as isopropyl variant |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.1 |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
0.1 |
|
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
No unacceptable risks to bystanders identified |
|
|
Protective clothing should be worn Possible risk from dermal exposure |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
May cause allergic reaction Possible liver and thyroid toxicant |
|
|
|
|
|
Not explosive or oxidising Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6,1 |
|
|
Health: H317, H351, H361 Environment: H400 |
|
|
Not listed |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
benthiavalicarb |
|
|
benthiavalicarbe |
|
|
Benthiavalicarb |
|
|
benthiavalicarb |
|
|
bentiavalicarb |
|
|
bentiavalicarb |
|
|
- |
|
|
bentiawalikarb |
|
|
- |
|
|
- |
|
|
- |
|
|
- |