| Benomyl (Ref: T 1991) |
(Also known as: benosan; kribenomy; D-1991; BBC; BNM) |
| Benomyl is a foliar fungicide used to control a broad range of fungal infections. It has a low aqueous solubility, is volatile, is slightly mobile and, based on its chemical properties, is not expected to leach to groundwater. It is generally not persistent in soil systems but may persist in some water systems under certain conditions. Benomyl has a low mammalian toxicity with a low potential for bioaccumulation. It is also reported to have harmful effects on human development/fertility. It is moderately toxic to birds, honeybees, earthworms and most aquatic organisms |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Endocrine distrupter; Reproduction/development effects
 |
|
|
A broad-spectrum foliar fungicide used to control a wide range of Ascomycetes and Fungi Imperfecti in a wide range of crops |
|
|
Fruit spot; Powdery mildew; Scab; Post-harvest decay; Blosson end rot; Blosson blight; Brown rot; Collar rot; Phoma leaf blotch; Black spot; Corm rot; Loose smut; Sclerotina rot |
|
|
Field crops; Nuts; Muschrooms; Ornamentals; Turf; Apples & pears; Peaches; Curcubits; Peppers; Peas; Grapes |
|
|
- |
|
|
Current |
|
|
1968, Introduced |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Germany |
|
|
Not applicable |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₁₈N₄O₃ |
|
|
CCCCNC(=O)N1C2=CC=CC=C2N=C1NC(=O)OC |
|
|
No data |
|
|
RIOXQFHNBCKOKP-UHFFFAOYSA-N |
|
|
InChI=1S/C14H18N4O3/c1-3-4-9-15-13(19)18-11-8-6-5-7-10(11)16-12(18)17-14(20)21-2/h5-8H,3-4,9H2,1-2H3,(H,15,19)(H,16,17,20) |
|
|
Yes |
|
|
Fungicide, Miticide |
|
|
Carbamate fungicide; Carbamate miticide; Benzimidazole fungiicde |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with protectant and eradicant activity. Also has ovicidal activity against mites. Inhibition of mitosis and cell division (Beta-tubulin assembly in mitosis) |
|
|
17804-35-2 |
|
|
241-775-7 |
|
|
206 |
|
|
099101 |
|
|
28780 |
|
|
613-049-00-3 |
|
|
290.32 |
|
|
methyl [1-(butylcarbamoyl)-1H-1,3-benzimidazol-2-yl]carbamate |
|
|
methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate |
|
|
methyl [1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]carbamate |
|
|
Chemical subject to PIC regulations (some formulations); Marine Pollutant; PAN Bad Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
1 |
|
|
- |
|
|
Tan coloured crystals |
|
|
|
|
|
- DuPont
- Dongbu Fine Chemicals Co. Ltd.
- King Tech
|
|
|
- Benlate
- Tersan 1991
- Benex
- Benefit
- Comply
- Agrocut
- Benosan
- Agway Rose And Garden Disease Control
- Alco Systemic Fungicide
|
|
|
Usually supplied as an oil dispersible product or as a wettable powder. |
|
|
|
|
|
|
|
2 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low |
|
|
94000 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data Chloroform |
- |
| 18000 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data Acetone |
- |
| 10000 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data Xylene |
- |
| 4000 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data Ethanol |
- |
|
|
Decomposes before melting |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
140 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
2.51 X 1001 |
Calculated |
- |
|
|
1.4 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
4.48 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
- |
| Weak acid |
|
|
0.005 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
4.00 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
67.0 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
|
0.8 |
H2 H = The US ARS pesticide properties database. Dataset is no longer available. 2 = Unverified data of unknown source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: Very variable data DT₅₀ 0.1-100 days, more usually 3-12 months |
|
|
|
6.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Apple leaves, n=1 |
|
|
|
1.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.6-1.8 days, 3 undercover grown crops, various matrices, n=3 |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
|
0.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Slightly mobile |
|
|
1900 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-0.07 |
Calculated |
Low leachability |
|
|
|
9.09 X 10-05 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
27 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Whole fish |
Low potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 10000 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
|
125 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
Moderate |
|
|
2500 |
- |
|
|
- |
- |
- |
|
|
1000 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
10.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
10 |
Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.17 |
Oncorhynchus mykiss |
Moderate |
|
|
0.011 |
Oncorhynchus mykiss LOEC |
Moderate |
|
|
0.28 |
Daphnia magna |
Moderate |
|
|
0.025 |
Daphnia magna LOEC |
Moderate |
|
|
0.14 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
2.2 |
Lemna gibba |
Moderate |
|
|
2 |
Scenedesmus acutus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 10000 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
2.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Eliminated in the faeces (20-45%) and the urine (40-70%). |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
May cause eye defects in new borns - anophthalmia May cause contact dermatitis and may be a skin sensitiser Endocrine issues - Increase of estrogen production and aromatase activity |
|
|
|
|
|
Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6,1 |
|
|
Health: H315, H317, H335, H340, H360FD Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
benomyl |
|
|
bénomyl |
|
|
Benomyl |
|
|
benomyl |
|
|
benomil |
|
|
benomil; benomyl |
|
|
benomyl |
|
|
benomyl |
|
|
benomyl |
|
|
benomil |
|
|
benomyl |
|
|
- |