| Benfuresate (Ref: NC 20484) |
(Not known by any other names) |
| Benfuresate is a post-emergence herbicide. It has a moderate aqueous solubility and is relatively volatile. It is not persistent in soil systems but not normally persistent in water. It has a low mammalian toxicity and a low potential for bioaccumulation. It is relatively non toxic to birds but moderately toxic to honeybees and most aquatic organisms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 |
|
|
A benzofuranyl alkylsulfonate herbicide used for post-emergence control of grass and broad-leaved weeds |
|
|
Barnyard grass; Goosegrass; Purple nutsedge; Wild oats; Black nightshade |
|
|
Paddy rice; Fruit; beans; Sugarcane; Cotton; Tobacco |
|
|
- |
|
|
- |
|
|
1980 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
No applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₂H₁₆O₄S |
|
|
CCS(=O)(=O)OC1=CC2=C(C=C1)OCC2(C)C |
|
|
No data |
|
|
QGQSRQPXXMTJCM-UHFFFAOYSA-N |
|
|
InChI=1S/C12H16O4S/c1-4-17(13,14)16-9-5-6-11-10(7-9)12(2,3)8-15-11/h5-7H,4,8H2,1-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Benzofuranyl herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibits lipid synthesis |
|
|
68505-69-1 |
|
|
270-925-4 |
|
|
8026 |
|
|
Not listed |
|
|
3034378 |
|
|
No data found |
|
|
256.3 |
|
|
3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl ethanesulfonate |
|
|
2,3-dihydro-3,3-dimethylbenzofuran-5-yl ethanesulfonate |
|
|
2,3-dihydro-3,3-dimethyl-5-benzofuranyl ethanesulfonate |
|
|
- |
|
|
- |
|
|
N |
|
|
8 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white crystals |
|
|
|
|
|
|
|
261 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderate |
|
|
1220000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 1050000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 1040000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 51000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyclohexane |
- |
|
|
30.01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
241 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
37.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
2.57 X 1002 |
Calculated |
- |
|
|
2.41 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.96 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Not applicable |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
| No dissociation |
|
|
1.43 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
19 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Lab studies DT₅₀ range 18-20 days, field studies DT₅₀ range 7-29 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
7 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderately fast |
|
|
- |
|
|
|
31 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
Not pH sensitive between pH 5 and 9.2 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately mobile |
|
|
214 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.10 |
Calculated |
Transition state |
|
|
|
6.87 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
22 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
|
3.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
60 |
- |
|
|
- |
- |
- |
|
|
> 10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 734 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 12.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 35.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
12.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 3.8 |
L1 L = Pesticide manuals and hard copy reference books / other sources 1 = Estimated data with little or no verification Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 4000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
5.34 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Not classified: Obsolete |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
benfuresate |
|
|
benfuresate |
|
|
Benfuresat |
|
|
benfuresat |
|
|
benfuresato |
|
|
benfuresato |
|
|
- |
|
|
benfuresat |
|
|
- |
|
|
- |
|
|
- |
|
|
- |