| Azinphos-ethyl (Ref: BAY 16259) |
(Also known as: azinphosethyl; triazotion; azinphos ethyl; R1513; ethyl gusathion; Bayer 17147) |
| Azinphos-ethyl is an organophosphate insecticide used to control sucking and chewing pests. It has a low aqueous solubility, relatively volatile and is not expected to leach to groundwater. It may be moderately persistent in some soil systems but is not expected to be persistent in water. It is toxic to mammals and there is also concern regarding its potential to bioaccumulate. It is a neurotoxicant and an acetyl cholinesterase inhibitor. Azinphos-ethyl is highly toxic to birds, fish and aquatic invertebrates. It is moderately toxic to honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
A benzotriazine organothiophosphate insecticide and organothiophosphate acaricide for the control of sucking and chewing pests |
|
|
Spider mites; Aphids; Caterpillers; Potato bugs including Colorado beetles; Oat mites; Tocks |
|
|
Cotton; Rice; Tobacco; Melons; Tomatoes; Potatoes; Hops; Beet crops; Citrus; Soybeans; Apples |
|
|
- |
|
|
- |
|
|
1955 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Germany |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₂H₁₆N₃O₃PS₂ |
|
|
CCOP(=S)(OCC)SCN1C(=O)C2=CC=CC=C2N=N1 |
|
|
No data |
|
|
RQVGAIADHNPSME-UHFFFAOYSA-N |
|
|
InChI=1S/C12H16N3O3PS2/c1-3-17-19(20,18-4-2)21-9-15-12(16)10-7-5-6-8-11(10)13-14-15/h5-8H,3-4,9H2,1-2H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| azinphos-ethyl |
- |
 |
|
|
Insecticide, Acaricide |
|
|
Organophosphate Insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
|
- |
|
|
FAO: acetone insolubles |
|
|
Synthetic |
|
|
Non-systemic, contact and stomach action. Cholinesterase inhibitor. Ovicidal. |
|
|
2642-71-9 |
|
|
220-147-6 |
|
|
485 |
|
|
058002 |
|
|
17531 |
|
|
015-056-00-1 |
|
|
345.38 |
|
|
O,O-diethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] phosphorodithioate |
|
|
S-3,4-dihydro-4-oxo-1,2,3-benzotriazin-3-ylmethyl O,O-diethyl phosphorodithioate |
|
|
O,O-diethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) phosphorodithioate |
|
|
Severe Marine Pollutant; Chemical subject to PIC regulations; PAN Bad Actor Chemical; Subject to the provisions of the UK Poisons Act 1972 |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Culex pipiens pipiens, Myzus persicae, Phorodon humuli |
|
|
Colourless needle-like crystals |
|
|
|
|
|
|
|
|
|
|
|
- Gusthion A
- Gusthion H
- Cotnion-ethyl
- Guthion M-E 4 Concentrate
|
|
|
Available in a variety of formulations including dusts, emulsifiable concentrates, ULVs and wettable powders. |
|
|
|
|
|
|
|
4.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
3500 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source n-Hexane |
- |
| 35000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Isopropanol |
- |
| 1000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 1000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
|
|
50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
111 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.51 X 1003 |
Calculated |
- |
|
|
3.18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
3.05 X 10-06 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
50 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
10 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Apple fruit, n=1; Apples in store RL₅₀ range 83-91 days, n=2 |
|
|
|
0.4 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
- |
|
|
|
13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source |
Slightly mobile |
|
|
1500 |
|
|
Other source Koc 1700 mL g⁻¹ estimate (CA2) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.40 |
Calculated |
Low leachability |
|
|
|
3.46 X 10-02 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
101 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
12 |
Rat |
High |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
2 |
- |
|
|
- |
- |
- |
|
|
> 12.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 1.39 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.08 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
|
- |
- |
- |
|
|
0.0002 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
12 |
Rat |
High |
|
|
500 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 24hr |
- |
|
|
0.15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
Interperitoneal LD₅₀ < 4.4 mg kg⁻¹ |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
Consumer exposure should be low or non-existent since azinphos ethyl is no longer produced or used in most of the developed world |
|
|
Occupational exposure should be low or non-existent since azinphos ethyl is no longer produced or used in most of the developed world |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Eliminated in the faeces (~60%) and urine (~40%) |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG TransportHazard Class 6.1 Not expected to autoignite; Not highly flammable |
|
|
Health: H300, H311 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN2783 |
|
|
- |
|
|
- |
|
|
|
|
|
azinphos-ethyl |
|
|
azinphos-ethyl |
|
|
Azinphos-ethyl |
|
|
azinphos-ethyl |
|
|
azinfos-etile |
|
|
azinfos-etil |
|
|
azinphos-ethyl |
|
|
azinofos etylowy |
|
|
- |
|
|
azinphos-ethyl |
|
|
azinfos-ethyl |
|
|
- |