| Anthracene oil |
(Also known as: paranaphthalene; bis-alkylamino ; green oil; tera olive) |
| Anthracene oil is a crop dessicant. It has a low aqueous solubility, non-mobile and is non-volatile. It is moderately persistent in most soil systems but not expected to be persistent in aqueous systems. Anthracene oil is moderately toxic to mammals but there is some concern regarding its potential to bioaccumulate. It is a skin irritant but there is no data to suggest any significant concerns for human health. It is moderately persistent to birds, fish and aquatic invertebrates |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health High alert: Carcinogen
 |
|
|
A hydrocarbon extracted from coal tar which has many purposes including its use as a crop desiccant, defoliant and wood preservative |
|
|
General pest control; Black rot; Lichens; Moss |
|
|
Dormant fruit trees and bushes |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₁₀ |
|
|
C1=CC=C2C=C3C=CC=CC3=CC2=C1 |
|
|
No data |
|
|
MWPLVEDNUUSJAV-UHFFFAOYSA-N |
|
|
InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| anthracene |
Source of the oil |
 |
|
|
Herbicide, Insecticide, Fungicide, Wood preservative, Disinfectant |
|
|
Petroleum derivative |
|
|
~97% |
|
|
phenanthrene, carbazole, napthothiopene |
|
|
Synthetic |
|
|
Contact action |
|
|
90640-80-5 |
|
|
120-12-7 |
|
|
292-602-7 |
|
|
8018 |
|
|
- |
|
|
8418 |
|
|
648-103-00-5 |
|
|
178.22 |
|
|
anthracene |
|
|
anthracene |
|
|
anthracene |
|
|
WFD priority substance |
|
|
EU Directive 2008/105/EC EQS for anthracene in surface waters: annual average 0.1 µg l⁻¹; max measured 0.4 µg l⁻¹ |
|
|
Not known |
|
|
Not known |
|
|
UNM |
|
|
Not applicable |
|
|
- |
|
|
Off-white to pale green crystals |
|
|
|
|
|
|
|
0.037 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
80 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.47 X 1004 |
Calculated |
- |
|
|
4.54 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.07 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
8.00 X 10-07 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
50 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
40 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
IUCLID-DataSheet Lab studies DT₅₀ range 17-60 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.33 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data |
Fast |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-mobile |
|
|
24362 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-0.62 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
387 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data Whole fish |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1955 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Mouse |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 1261 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
Q1 Q = Miscellaneous data from online sources 1 = Estimated data with little or no verification Toxic |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 0.49 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 4.3 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.01 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Lemna gibba 8 day |
Moderate |
|
|
0.007 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Unknown species |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1955 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Mouse |
Moderate |
|
|
1320 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
Corrosive |
|
|
Health: H350 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
anthracene oil |
|
|
huile d'anthracène |
|
|
Anthracenoel |
|
|
anthracenolie |
|
|
olio d'antracene |
|
|
aceite del antraceno |
|
|
- |
|
|
olej antracenowy |
|
|
- |
|
|
- |
|
|
antraceenolie |
|
|
- |