| Amitraz (Ref: ENT 27967) |
(Also known as: amitraze; amitrazum ; BTS 27419; BAAM; U-36059) |
| Amitraz is an amidine acaricide and insecticide. It is volatile, almost insoluble in water and, based on its chemical properties, is only slightly mobile with a low potential for leaching to groundwater. It is not persistent in soil systems, degradation being very rapid and would also not be expected to persistent in surface water under normal conditions. Amitraz has a moderate mammalian toxicity and there is some concern regarding its potential for bioaccumulation. It is considered to be a neurotoxin. Amitraz has a high to moderate toxicity to most terrestrial and aquatic species, the main exception being algae for which amitraz has a low level of toxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 |
Human health High alert: Neurotoxicant
 |
|
|
An amidine acaricide and insecticide for use in top fruit, ornamentals and some vegetables. Also has veterinary treatment applications. |
|
|
Bollworm; Budworm; Red spider mites; Leaf miners; Scale insects; Aphids; Ticks; Psyllids; Varroa mite |
|
|
Fruit including apples, pears and plums; Ornamentals; Some vegetables; Cotton; Livestock; Bees |
|
|
- |
|
|
Current |
|
|
circa 1972 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Austria |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₉H₂₃N₃ |
|
|
CC1=CC(=C(C=C1)N=CN(C)C=NC2=C(C=C(C=C2)C)C)C |
|
|
- |
|
|
QXAITBQSYVNQDR-UHFFFAOYSA-N |
|
|
InChI=1S/C19H23N3/c1-14-6-8-18(16(3)10-14)20-12-22(5)13-21-19-9-7-15(2)11-17(19)4/h6-13H,1-5H3/b20-12+,21-13+ |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| amitraz |
- |
 |
|
|
Insecticide, Acaricide, Veterinary substance |
|
|
Amidine insecticide; Formamidine insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic having contact and respiratory action. Acts on nervous system. Octopamine receptor agonist. |
|
|
33089-61-1 |
|
|
251-375-4 |
|
|
362 |
|
|
106201 |
|
|
36324 |
|
|
612-086-00-2 |
|
|
293.41 |
|
|
N'-(2,4-dimethylphenyl)-N-{[(2,4-dimethylphenyl)imino]methyl}-N-methylmethanimidamide |
|
|
N,N'-[(methylimino)dimethylidyne]di-2,4-xylidine |
|
|
N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methylmethanimidamide |
|
|
PAN Bad Actor Chemical; Cannot be used on horses |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
19 |
|
|
Not applicable |
|
|
Panonychus citri, Tetranychus cinnabarinus, Tetranychus urticae, Boophilus microplus, Cacopsylla pyri |
|
|
Straw coloured crystalline solid |
|
|
|
|
|
- FCC
- Agropharm
- Kingtai Chemicals
- Makhteshim
|
|
|
- Mitac WP
- Triazid
- Amipaz
- Zamir
|
|
|
Usually supplied as emulsifiable concentrates or wettable powders for crop use and solutions for livestock topical administration |
|
|
|
|
|
|
|
0.1 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
87 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.16 X 1005 |
Calculated |
- |
|
|
5.5 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.13 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
9.8 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
| Weak acid |
|
|
0.051 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
1.06 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
0.2 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
0.2 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
1 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature DT₅₀ studies range 0.1-2 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
6.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 5.0-7.3 days, 2 field crops, various matrices, n=2 |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Stable in UV light |
|
|
|
1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
pH sensitive: DT₅₀ 2hrs at pH 5, 1.1 days at pH 9, rapid hydrolysis |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
1000 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.00 |
Calculated |
Low leachability |
|
|
|
1.92 X 10-04 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
1838 |
|
Threshold for concern |
|
|
Not available |
- |
|
|
|
|
|
|
|
Major fraction |
- |
- |
|
|
Minor fraction |
- |
- |
|
|
Minor fraction |
- |
Anaerobic |
|
|
Minor fraction |
- |
Aerobic |
|
|
Minor fraction |
- |
Aerobic |
|
|
Minor fraction |
- |
Anaerobic |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
800 |
Rat |
Moderate |
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat 2 year |
- |
|
|
50 |
- |
|
|
- |
- |
- |
|
|
788 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Moderately harmful at dose 360 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmful at dose 360 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.74 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
> 0.00353 |
Pimephales promelas |
High |
|
|
0.035 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
0.002 |
Daphnia magna LOEC |
High |
|
|
4.7 |
Americamysis bahia |
Moderate |
|
|
> 8.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Chironomus riparius 48hr |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
12 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
800 |
Rat |
Moderate |
|
|
200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
65.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
Intraperitoneal LD₅₀ = 800 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
0.003 |
|
- |
|
|
0.01 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
In mammals urine is the major route of excretion. 55-74% of the dose was excreted after dosing within first 24hrs |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Ingestion may cause slow heart beat, low blood pressure, sedation and low body temperature |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
Health: H302, H317, H373 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
amitraz |
|
|
amitraze |
|
|
Amitraz |
|
|
amitraz |
|
|
amitraz |
|
|
amitraz |
|
|
amitraz |
|
|
amitraz |
|
|
- |
|
|
amitraz |
|
|
amitraz |
|
|
- |