| Aminocarb (Ref: BAY 44646) |
(Also known as: ENT 25784 ; matacil) |
| Aminocarb is an obsolete insecticide. It is highly soluble in water, has a low volatility and tends to be non-persistent in soil and aquatic ecosystems. Based on its chemical properties it is not expected to leach to groundwater. It is highly toxic to mammals and many animal species including pollinators. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia chronic ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High
 |
|
|
An obsolete insecticide used mainly in forestry for the control of biting insects |
|
|
Spruce budworm larvae; Lepidopterous larvae |
|
|
Forestry especially spruce trees |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
Circa 1965 developed; 1973, first registered. |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₁₆N₂O₂ |
|
|
CC1=C(C=CC(=C1)OC(=O)NC)N(C)C |
|
|
No data |
|
|
IMIDOCRTMDIQIJ-UHFFFAOYSA-N |
|
|
InChI=1S/C11H16N2O2/c1-8-7-9(15-11(14)12-2)5-6-10(8)13(3)4/h5-7H,1-4H3,(H,12,14) |
|
|
Yes |
|
|
Insecticide |
|
|
Carbamate insecticide |
|
|
>97% |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic, acetylcholinesterase (AChE) inhibitor. |
|
|
2032-59-9 |
|
|
217-990-7 |
|
|
293 |
|
|
205100 |
|
|
7157 |
|
|
006-018-00-5 |
|
|
208.26 |
|
|
4-(dimethylamino)-3-methylphenyl methylcarbamate |
|
|
4-dimethylamino-m-tolyl methylcarbamate |
|
|
4-(dimethylamino)-3-methylphenyl methylcarbamate |
|
|
Marine Pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1A |
|
|
Not applicable |
|
|
None identified |
|
|
White to beige coloured crystalline solid |
|
|
|
|
|
|
|
915 |
|
High |
|
|
- |
- |
- |
|
|
93.9 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
7.94 X 1001 |
Calculated |
- |
|
|
1.90 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.10 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
10.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately volatile |
|
|
5.71 X 10-07 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
6.0 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
USDA data |
|
|
|
11.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 4.5-19.2 days, tree foliage, n=2 |
|
|
|
5.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.1-10.9 days, tree foliage & green bean plant, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
14.2 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-persistent |
|
|
pH sensitive: DT₅₀ 17.3 days at pH6, 6.2 days at pH 8, all at 25 °C |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
|
100 |
|
|
Other source Koc 100-210 mL g⁻¹ (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.56 |
Calculated |
Low leachability |
|
|
|
5.12 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
6 |
Based on LogP < 3 |
Low potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
30 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 23.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Anas platyrhynchos |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 0.121 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Apis mellifera 48 hour |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 3.07 |
R4 R = Peer reviewed scientific publications 4 = Verified data Bombus terricola 48 hour |
Moderate |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.06 |
R4 R = Peer reviewed scientific publications 4 = Verified data Andrena erythronii |
High |
|
|
Contact |
|
|
|
0.068 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
|
Contact |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 0.110 |
Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
> 0.19 |
Daphnia magna |
Moderate |
|
|
< 0.0016 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
0.377 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Chironomus riparius 24 hour |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.56 |
Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
30 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
High |
|
|
275 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin or by inhalation |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Ingestion may cause abdominal cramps, diarrhoea, nausea and vomiting |
|
|
|
|
|
Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6,1 |
|
|
Health: H301, H311 Environment: H400, H410 |
|
|
Not classified: Obsolete |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
aminocarb |
|
|
aminocarbe |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
aminokarb |
|
|
- |
|
|
- |
|
|
- |
|
|
- |