| Allidochlor (Ref: CP 6343) |
(Also known as: CDAA; alidochlor; CDAAT; randox; alidochlore ) |
| Allidochlor is herbicide that is not generally approved for use in the developed world. It has a high potential for bioconcentration, has a moderate mammalian toxicity and a known skin and eye irritant. Allidochlor is highly soluble in water and highly volatile. It is not persistent in the soil but is mobile. It is moderately toxic to fish. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate
 Warning: Significant data are missing |
|
|
An obsolete herbicide used for the control of most annual grasses and certain broad-leaved weeds in a variety of crops |
|
|
Bluegrass; Barnyard grass; Pigweed; Carpetweed; Foxtail; Purslane; Crabgrass; Stinkgrass; Quackgrass |
|
|
Corn; Vegetables including beans, cabbage, peas, onions, celery; Fruit; Ornamentals; Soybeans |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
circa 1958 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₈H₁₂ClNO |
|
|
C=CCN(CC=C)C(=O)CCl |
|
|
Not applicable |
|
|
MDBGGTQNNUOQRC-UHFFFAOYSA-N |
|
|
InChI=1S/C8H12ClNO/c1-3-5-10(6-4-2)8(11)7-9/h3-4H,1-2,5-7H2 |
|
|
Yes |
|
|
Herbicide |
|
|
Amide herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Translocates and inhibits cell division causing plant death. Inhibition of cell respiration. Inhibition of Very Long-Chain Fatty Acid Synthesis. Selective. |
|
|
93-71-0 |
|
|
202-270-7 |
|
|
132 |
|
|
019301 |
|
|
7157 |
|
|
616-004-00-6 |
|
|
173.64 |
|
|
2-chloro-N,N-di(prop-2-en-1-yl)acetamide |
|
|
N,N-diallyl-2-chloroacetamide |
|
|
2-chloro-N,N-di-2-propenylacetamide |
|
|
- |
|
|
- |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Oily amber coloured liquid |
|
|
|
|
|
|
|
|
- Randox
- Randox T
- Actox Granular Selective Weed Killer
- Cdaa 20 G Selective Herbicide
|
|
|
Usually supplied as an emuslifiable concentrate |
|
|
|
|
|
|
|
197000 |
|
High |
|
|
- |
- |
- |
|
|
25 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
74 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
186 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
|
6.76 X 1001 |
Calculated |
- |
|
|
1.83 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.088 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
4.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
| Weak acid |
|
|
1250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature states 2 to 3 weeks; Other data e.g. USDA 10 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Mobile |
|
|
20 |
|
|
Other sources: 67.6 mL g⁻¹ (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.51 |
Calculated |
High leachability |
|
|
|
3.77 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
|
| 2-hydroxyethanoic acid |
glycollic acid |
- |
- |
- |
| diallylamine |
- |
- |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
290 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
2.0 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
10.0 |
Chlorella pyrenoidosa |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
290 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
Moderate |
|
|
830 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Harmful if swallowed |
|
|
|
|
|
Emits toxic fumes when heated Corrosive IMDG Transport Hazard Class 6.1 |
|
|
Health: H302, H312, H315, H319 Environment: H411 |
|
|
II (Moderately hazardous) |
|
|
UN2810 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
allidochlor |
|
|
alidochlore |
|
|
Allidochlor |
|
|
- |
|
|
- |
|
|
alidocloro |
|
|
- |
|
|
alidochlor |
|
|
- |
|
|
- |
|
|
- |
|
|
- |