| Alanycarb |
(Also known as: alanycarbe; alanicarb) |
| Alanycarb is an obsolete broad-range carbamate insecticide. It has a low aqueous solubility and is relatively volatile. It tends not to be presistent in soil systems but may persist in water. It has a moderate mammalian toxicity and there is slight concern regarding possible bioaccumulation. It is an acetyl cholinesterase inhibitor. Alanycarb is moderately toxic to fish and aquatic invertebrates, highly toxic to honeybees but is relatively non-toxic to birds.. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Bees acute contact ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor
 Warning: Significant data are missing |
|
|
A broad range oxime carbamate insecticide and nematicide |
|
|
Aphids; Lacebugs; Mealybugs; Whiteflies; Springtails |
|
|
Fruit including apples, pears, grapes and citrus; Vegetables including brassicas; Tobacco; Cotton; Beets |
|
|
- |
|
|
- |
|
|
1984, first reported; 1991, Introduced Japan |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
France |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₇H₂₅N₃O₄S₂ |
|
|
CCOC(=O)CCN(CC1=CC=CC=C1)SN(C)C(=O)ON=C(C)SC |
|
|
CCOC(=O)CCN(CC1=CC=CC=C1)SN(C)C(=O)O/N=C(/C)\SC |
|
|
GMAUQNJOSOMMHI-JXAWBTAJSA-N |
|
|
InChI=1S/C17H25N3O4S2/c1-5-23-16(21)11-12-20(13-15-9-7-6-8-10-15)26-19(3)17(22)24-18-14(2)25-4/h6-10H,5,11-13H2,1-4H3/b18-14- |
|
|
Yes |
|
|
Insecticide |
|
|
Carbamate insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Contact and stomach action. Acetylcholinesterase (AChE) inhibitor. |
|
|
83130-01-2 |
|
|
617-01-2 |
|
|
576 |
|
|
- |
|
|
9576091 |
|
|
No data found |
|
|
399.53 |
|
|
ethyl (3Z)-9-benzyl-3,7-dimethyl-6-oxo-5-oxa-2,8-dithia-4,7,9-triazadodec-3-en-12-oate |
|
|
ethyl (Z)-N-benzyl-N-[[methyl(1-methylthioethylideneaminooxycarbonyl)amino]thio]-β-alaninate |
|
|
ethyl (3Z)-3,7-dimethyl-6-oxo-9-(phenylmethyl)-5-oxa-2,8-dithia-4,7,9-triazadodec-3-en-12-oate |
|
|
PAN Bad Actor Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1A |
|
|
Not applicable |
|
|
None identified |
|
|
Pale yellow solid |
|
|
|
|
|
|
|
|
|
|
|
Available as emulsifiable concentrates and wettable powders for foliar, soil or seed treatments |
|
|
|
|
|
|
|
20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
950000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Toluene |
- |
| 950000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Acetone |
- |
| 950000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethyl acetate |
- |
|
|
46.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.69 X 1003 |
Calculated |
- |
|
|
3.43 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.21 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.0047 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
1.74 X 10-08 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
164 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
|
|
|
|
|
|
|
Major fraction |
- |
- |
|
|
Major fraction |
- |
- |
|
|
Minor fraction |
- |
- |
|
|
Minor fraction |
- |
- |
|
|
Minor fraction |
- |
- |
|
|
Minor fraction |
- |
- |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
| acetonitrile |
- |
Plant; Animal |
- |
- |
| acetic acid |
- |
Plant; Animal |
- |
- |
| ethyl N-benzyl-beta-alaninate |
- |
Plant |
- |
- |
| N-benzyl-beta-alaninate |
- |
Animal |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
330 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
3553 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinidae |
Moderate |
|
|
- |
- |
- |
|
|
9.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
330 |
Rat |
Moderate |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
0.205 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk to Europeans as no longer approved for use |
|
|
Low risk to Europeans as no longer approved for use |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Moderately toxic |
|
|
|
|
|
IMDG Transport Hazard Class 6,1 |
|
|
Health: H302, H330 Environment: H400 |
|
|
II (Moderately hazardous) |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
alanycarb |
|
|
alanycarbe |
|
|
Alanycarb |
|
|
alanycarb |
|
|
alanycarb |
|
|
alanycarb |
|
|
- |
|
|
alanykarb |
|
|
- |
|
|
- |
|
|
- |
|
|
- |