| Alachlor (Ref: CP 50144 ) |
(Also known as: alachlore; acetanilide; methachlor; metachlor; CDMA) |
| Alachlor is a pre-emergence chloroacetanilide herbicide. It is moderately soluble in water, quite volatile and is not expected to readily leach to groundwater. It tends not to persist in either soil or water systems. It has a moderate mammalian toxicity and a low potential for bioaccumulation. Alachlor is moderately toxic to birds, most aquatic organisms, honeybees and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen; Possible Endocrine distrupter; Possible Reproduction/development effects
 |
|
|
A chloroacetanilide herbicide for pre-emergence control of annual grasses and broad-leaved weeds |
|
|
Goosegrass; Crab grass; Herringbone grass; Sweet buffalo grass; Barnyard grass; Nutsedge; Pigweed; Sow thistle; Purslane; Chickweed |
|
|
Maize; Potatoes; Soybean; Sunflowers; Brassicas; Pineapples; Sugarcane |
|
|
- |
|
|
Current |
|
|
1969 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Spain |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₂₀ClNO₂ |
|
|
CCC1=C(C(=CC=C1)CC)N(COC)C(=O)CCl |
|
|
No data |
|
|
XCSGPAVHZFQHGE-UHFFFAOYSA-N |
|
|
InChI=1S/C14H20ClNO2/c1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| alachlor |
- |
 |
|
|
Herbicide |
|
|
Chloroacetanilide herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic action absorbed by germinating shoots. Inhibition of VLCFA (inhibition of cell division) |
|
|
15972-60-8 |
|
|
240-110-8 |
|
|
204 |
|
|
090501 |
|
|
2078 |
|
|
616-015-00-6 |
|
|
269.77 |
|
|
2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide |
|
|
2-chloro-2',6'-diethyl-N-methoxymethylacetanilide |
|
|
2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide |
|
|
WFD priority substance; OSPAR candidate; Potential groundwater contaminant; Chemical subject to PIC regulations; PAN Bad Actor |
|
|
EU Directive 2008/105/EC EQS surface waters: annual average 0.3 µg l⁻¹; max measured 0.7 µg l⁻¹ |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless/yellow crystals |
|
|
|
|
|
- Monsanto
- Makhteshim-Agan
- Pillar International
|
|
|
- Lasso
- Alanex
- Pillarzo
- Bullet
- Cannon
- Bronco
|
|
|
Usually supplied as emulsifiable concentrates, microscopic capsules and granules |
|
|
|
|
|
|
|
240 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Moderate |
|
|
- |
- |
- |
|
|
41 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
100 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
105 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
137 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
|
1.23 X 1003 |
Calculated |
- |
|
|
3.09 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.13 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
0.62 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
| Strong acid |
|
|
2.9 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low volatility |
|
|
3.20 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
14 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Non-persistent |
|
|
35 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
14 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Field studies DT₅₀ range 1-3 weeks; Other sources: DT₅₀ 80 days (R2) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.5 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Fast |
|
|
Stable to UV light |
|
|
|
0.5 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Non-persistent |
|
|
- |
|
|
2 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data |
Fast |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately mobile |
|
|
335 |
|
|
- |
|
|
|
16.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slightly mobile |
|
|
1994 |
|
|
0.81 |
|
|
Literature values: Kf range 11.8-20.5 mL g⁻¹; Kfoc range 339-4214 mL g⁻¹, 1/n range 0.70-0.91, Soils = 5 |
|
|
- |
|
|
|
|
|
|
|
0.80 |
Calculated |
Low leachability |
|
|
|
1.31 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
39 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
930 |
Rat |
Moderate |
|
|
|
10 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
High |
|
|
200 |
- |
|
|
- |
- |
- |
|
|
1536 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
386.8 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
16 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.8 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Oncorhynchus mykiss |
Moderate |
|
|
0.19 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Unknown species |
Moderate |
|
|
10 |
Daphnia magna |
Moderate |
|
|
0.22 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.01 |
Lemna minor |
Moderate |
|
|
0.966 |
Scenedesmus quadricauda |
Moderate |
|
|
0.02 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Chlorella pyrenoidosa |
Moderate |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
930 |
Rat |
Moderate |
|
|
13300 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
1.04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk to Europeans as no longer approved for use |
|
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
Non-statutory WHO drinking water guideline 0.02 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
US Toxics Release Inventory (TRI) Program listed carcinogen Probable lung and kidney toxicant Causes irreversible eye damage Possibly genotoxic Endocrine issues - Competitive binding to estrogen and progesterone receptors |
|
|
|
|
|
Corrosive IMDG Transport Hazard Class 9 |
|
|
Health: H302, H317, H351 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
Chemically stable under standard ambient conditions |
|
|
|
|
|
alachlor |
|
|
alachlore |
|
|
Alachlor |
|
|
alachlor |
|
|
alaclor |
|
|
alacloro |
|
|
- |
|
|
alachlor |
|
|
- |
|
|
alachlor |
|
|
alachloor |
|
|
- |