| Afidopyropen (Ref: ME 5343) |
(Also known as: coprapidpen; BAS 440 I) |
| Afidopyropen is an insecticide. It is moderately persistent in soil and water. It is moderately mobile and may leach to groundwaters. It has a favourable biodiversity toxcityl profile and is not highly toxic to bees. Whilst it has a low oral toxicity to mammals there are some conserns that afidopyropen may be carcinogenic. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Non-persistent
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Carcinogen
 |
|
|
An insecticide that is effective against sucking insects |
|
|
Aphids; Spidermites; Whitefly; Thrips; Psyllids; Mealybugs, Scale |
|
|
Fruit; Vegetables; Nuts; Cotton; Ornamentals |
|
|
- |
|
|
Current |
|
|
2013 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric |
|
|
C₃₃H₃₉NO₉ |
|
|
CC12CCC(C(C1CC(C3(C2C(C4=C(O3)C=C(OC4=O)C5=CN=CC=C5)O)C)O)(C)COC(=O)C6CC6)OC(=O)C7CC7 |
|
|
C[C@]12CC[C@@H]([C@@]([C@@H]1C[C@@H]([C@@]3([C@@H]2[C@H](C4=C(O3)C=C(OC4=O)C5=CN=CC=C5)O)C)O)(C)COC(=O)C6CC6)OC(=O)C7CC7 |
|
|
LRZWFURXIMFONG-HRSIRGMGSA-N |
|
|
InChI=1S/C33H39NO9/c1-31-11-10-24(42-29(38)18-8-9-18)32(2,16-40-28(37)17-6-7-17)22(31)14-23(35)33(3)27(31)26(36)25-21(43-33)13-20(41-30(25)39)19-5-4-12-34-15-19/h4-5,12-13,15,17-18,22-24,26-27,35-36H,6-11,14,16H2,1-3H3/t22-,23+,24+,26+,27-,31+,32+,33-/m1/s1 |
|
|
Yes |
|
|
Insecticide |
|
|
Pyropene insecticide; Organic heterotetracyclic compound |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Disrupts insect feeding behaviour. A chlordotonal orgn TRPV (transient receptor potential vanilloid) channel modulatot |
|
|
915972-17-7 |
|
|
815-966-6 |
|
|
None allocated |
|
|
7969 |
|
|
54589430 |
|
|
No data found |
|
|
593.7 |
|
|
- |
|
|
((3S,4R,4aR,6S,6aS,12R,12aS,12bS)-3-(cyclopropylcarbonyloxy)-1,2,3,4,4a,5,6,6a,12a,12b-decahydro-6,12-dihydroxy-4,6a,12b-trimethyl-11-oxo-9-(3-pyridyl)-11H,12H-benzo(f)pyrano(4,3-b)chromen-4-yl)methyl cyclopropanecarboxylate |
|
|
((3S,4R,4aR,6S,6aS,12R,12aS,12bS)-3-((cyclopropylcarbonyl)oxy)-1,3,4,4a,5,6,6a,12,12a,12b-decahydro-6,12-dihydroxy-4,6a,12b-trimethyl-11-oxo-9-(3-pyridinyl)-2H,11H-naphtho(2,1-b)pyrano(3,4-e)pyran-4-yl)methyl cyclopropanecarboxylate |
|
|
- |
|
|
Possible groundwater pollutants |
|
|
Not applicable |
|
|
Not applicable |
|
|
9D |
|
|
Not applicable |
|
|
- |
|
|
The technical maaterial is a yellow powder |
|
|
|
|
|
|
|
|
- Sefina
- Versys
- Ventigra
- Inscalis
|
|
|
- |
|
|
|
|
|
|
|
25.1 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
55400 |
E4 E = Manufacturers safety data sheets 4 = Verified data Toluene |
- |
| 500000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Methanol |
- |
| 500000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Acetone |
- |
| 500000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Ethyl acetate |
- |
|
|
150 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.82 X 1003 |
Calculated |
- |
|
|
3.45 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
9.99 X 10-03 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low volatility |
|
|
2.34 X 10-04 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
8.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Non-persistent |
|
|
8.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature: aerobic DT₅₀ 2.7-18.6 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Stable |
|
|
Stable at all environmntally relevant pH values |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 802 |
E4 E = Manufacturers safety data sheets 4 = Verified data Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 200 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Apis mellifera |
Low |
|
|
> 100 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
78.1 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Unknown species |
- |
|
|
140.4 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Unknown species |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 18.3 |
E4 E = Manufacturers safety data sheets 4 = Verified data Pimephales promelas |
Moderate |
|
|
- |
- |
- |
|
|
> 8.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
> 5.48 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
No information available |
|
|
|
|
|
Not explosive or oxidising Not expected to autoignite; Not highly flammable |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
afidopyropen |
|
|
afidopyropene |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |