| Acifluorfen (Ref: RH 5781) |
(Also known as: acifluorofen; acifluorfen metabolite; lactofen metabolite; PPG 847; carbofluorfen) |
| Acifluorfen is a post-emergence herbicide, usually used as the sodium salt. It is highly soluble in water, with a low vapour pressure and may be moderately persistent in soils and water depending upon conditions. Based on its chemical properties it has a high potential for leaching to groundwater. It has a low to moderate toxicity to most biodiversity. It is not highly toxic to human but is known to be a skin and eye irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen; Possible Reproduction/development effects
 |
|
|
Post emergence herbicide, usually used as the sodium salt; particularly effective against broad-leaved weeds and grasses. Also a pesticide transformation product. |
|
|
Carpetweed; Balloonvine; Wild buckwheat; Cocklebur; Ladysthumb; Lambsquarters; Copperleaf; Morning glory; Moonflower; Nightshade; Pigweed; Foxtails |
|
|
Soybean; Peanuts; Rice |
|
|
- |
|
|
Current |
|
|
1980, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₇ClF₃NO₅ |
|
|
C1=CC(=C(C=C1C(F)(F)F)Cl)OC2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O |
|
|
No data |
|
|
NUFNQYOELLVIPL-UHFFFAOYSA-N |
|
|
InChI=1S/C14H7ClF3NO5/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21/h1-6H,(H,20,21) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| acifluorfen |
- |
 |
|
|
Herbicide, Metabolite |
|
|
Soil |
|
|
Nitrophenyl ether herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Contact action. Inhibition of protoporphyrinogen oxidase (PPO). |
|
|
50594-66-6 |
|
|
256-634-5 |
|
|
497 |
|
|
114401 |
|
|
44073 |
|
|
604-041-00-0 |
|
|
361.66 |
|
|
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
|
|
5-(2-chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrobenzoic acid |
|
|
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
|
|
Chemical subject to PIC regulations; Potential groundwater pollutant; PAN Bad Actor |
|
|
- |
|
|
E |
|
|
14 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white coloured solid |
|
|
|
|
|
|
|
|
- Rohm and Haas
- United Phosphorus
|
|
|
|
|
|
- |
|
|
|
|
|
|
|
250000 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
High |
|
|
50000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Acetone |
- |
| 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source n-Hexane |
- |
|
|
155 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
235 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
1.51 X 1001 |
Calculated |
- |
|
|
1.18 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
3.86 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.133 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
54 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ 108 (silt loam) - 200 (clay) days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
4 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderately fast |
|
|
- |
|
|
|
Stable |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G2 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 2 = Unverified data of unknown source |
Moderately mobile |
|
|
113 |
|
|
- |
|
|
|
13.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
|
160 |
|
|
1.05 |
|
|
Literature data: Kf range 0.57-43.11 mL g⁻¹, Kfoc range 65.3-291.3 mL.g, 1/n range 0.952-1.190, Soils=5 |
|
|
- |
|
|
|
|
|
|
|
3.11 |
Calculated |
High leachability |
|
|
|
3.53 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1370 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2821 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida as sodium salt |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
G2 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
54 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
28 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1370 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat |
Moderate |
|
|
2000 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rabbit |
- |
|
|
6.9 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Slightly toxic Liver, heart, and kidney toxicant at high doses |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
Health: H302, H315, H318 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
acifluorfen |
|
|
- |
|
|
- |
|
|
acifluorfen |
|
|
- |
|
|
acifluorfen |
|
|
- |
|
|
acifluorfen |
|
|
- |
|
|
acifluorfen |
|
|
- |
|
|
- |