| ACC |
(Not known by any other names) |
| ACC is an amino acid herbicide and plant growth regulator. It is soluble in water but much less so in organic solvents. Published data regarding its environmental fate are limited. Soil degradation is expected to be rapid. ACC is quite mobile. It has a low to moderate toxicity to terrestrial aminals and a low to moderate toxicity to most aquatic life the execption being algae where it is considered highly toxic. No significant concerns have been identified concerning human health. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
An ethylene releasing substance used as a plant growth regulator to aid maturation |
|
|
Ripening process |
|
|
Field crops; Fruit trees including apples |
|
|
- |
|
|
Current |
|
|
1979, first discovered |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₄H₇NO₂ |
|
|
C1CC1(C(=O)O)N |
|
|
- |
|
|
PAJPWUMXBYXFCZ-UHFFFAOYSA-N |
|
|
InChI=1S/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7) |
|
|
Yes |
|
|
Herbicide, Plant Growth Regulator |
|
|
Amino acid herbicide; Ethylene emitter |
|
|
>98.56% |
|
|
- |
|
|
Synthetic |
|
|
As an ethylene releasing substance it affects the growth and development of plants as well as their senescence. |
|
|
22059-21-8 |
|
|
217-162-5 |
|
|
None allocated |
|
|
- |
|
|
535 |
|
|
No data found |
|
|
101.1 |
|
|
1-aminocyclopropane-1-carboxylic acid |
|
|
1-aminocyclopropanecarboxylic acid |
|
|
1-aminocyclopropanecarboxylic acid |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White to off-white coloured powder |
|
|
|
|
|
- |
|
|
- |
|
|
Usually supplied as wettable granules |
|
|
|
|
|
|
|
72000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
|
0.2 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Hexane |
- |
| 0.2 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Xylene |
- |
| 0.2 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Dichloromethane |
- |
| 300 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Acetone |
- |
|
|
Decomposes on melting |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
Decomposes before boiling |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.26 X 10-03 |
Calculated |
- |
|
|
-2.9 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.41 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.0036 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low volatility |
|
|
- |
- |
- |
|
|
P4 |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.4 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
[Canada Health: DT₅₀ range 0.81 days (sandy clay loam) to 3.4 days (sandy loam) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Slightly mobile |
|
|
1000 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.15 |
Calculated |
Low leachability |
|
|
|
3.56 X 10-04 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
3.16 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4974 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
343 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Colinus virginianus |
Moderate |
|
|
1712 mg kg⁻¹ BW per day |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Colinus virginianus |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 120.9 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Apis mellifera |
Low |
|
|
> 254.4 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 117 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
> 105 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Low |
|
|
11.3 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.037 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Pseudokirchneriella subcaptata |
Moderate |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 4974 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
|
3000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
- |
|
|
> 5.10 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No information available |
|
|
|
|
|
Not an explosion hazard Incompatible with strong oxidising agents |
|
|
health: H315, H319, H335 |
|
|
- |
|
|
Not regulated |
|
|
- |
|
|
The product is chemically and physically stable under usual commercial packaging up to 54 DegC over 14 days |
|
|
|
|
|
ACC |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |