| (4-chlorophenoxy)acetic acid | (Also known as: (4-chlorophenoxy)acetic acid ; PCPA; 4-CPA; 4-ChFu; 4-CPA) |
| SUMMARY |
| 4-CPA is a plant growth regulator. It is highly soluble in water and is quite volatile. Little is known about its persistence in soil and aquatic systems. It is moderately toxic to mammals and has a high potential for bioaccumulation. It is also a recognised irritant. It is moderately toxic to birds, honeybees and most aquatic organisms. However, it has a relatively low toxicity to fish. |
| Data alerts |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate | Ecotoxicity | Human health |
|---|---|---|
Warning:Significant data are missing |
Warning:Significant data are missing |
|
|
A plant growth regulator used fruit setting and thining | |
|---|---|---|
|
Growth - in terms of thinging and fruit set | |
|
Tomatoes; Grapes | |
|
- | |
|
Current | |
|
Current |
| UK regulatory status |
|
Not approved | ||
|---|---|---|---|
|
Expired | ||
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
| Additional information |
|
- |
|---|
| Chemical structure |
|
None | |
|---|---|---|
|
C₈H₇ClO₃ | |
|
C1=CC(=CC=C1OCC(=O)O)Cl | |
|
No data | |
|
SODPIMGUZLOIPE-UHFFFAOYSA-N | |
|
InChI=1S/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) | |
|
Yes |
|
| Common Name | Relationship | Link |
|---|---|---|
| (4-chlorophenoxy)acetic acid | - | ![]() |
| General status |
|
Plant Growth Regulator, Herbicide | |
|---|---|---|
|
Auxin PGR | |
|
- | |
|
- | |
|
Synthetic | |
|
Auxin-transport inhibitor. Absorbed by tissue and translocated to roots | |
|
122-88-3 | |
|
204-581-3 | |
|
291 | |
|
019401 | |
|
26229 | |
|
607-073-00-3 | |
|
186.59 | |
|
(4-chlorophenoxy)acetic acid | |
|
4-chlorophenoxyacetic acid | |
|
(4-chlorophenoxy)acetic acid | |
|
- | |
|
- | |
|
P | |
|
19 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Off-white crystalline solid |
| Formulations |
|
|
|||
|---|---|---|---|---|
|
|
|||
|
|
|||
|
Available in a range of formulations including aerosols, liquids and tablets |
|
|
|
|
|
||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
957 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )
3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
157 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )
3 = Unverified data of known source |
- | ||||||||
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )
3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.78 X 1002 | Calculated | - | |||||||
|
2.25 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )
3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
1.52 |
L3 L = Pesticide manuals and hard copy reference books /
other sources
3 = Unverified data of known source |
- | ||||||||
|
3.01 |
DW4 DW = Don Wauchope personal database for Pka data:
Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a
database and comparison with predicted values. Dataset is no longer available.
4 = Verified data |
- | ||||||||
| Weak acid | |||||||||||
|
2.40 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books /
other sources
3 = Unverified data of known source |
Low volatility | ||||||||
|
6.48 X 10-08 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )
3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
| Degradation |
|
|
|
|
||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
| Soil adsorption and mobility |
|
|
|
|
||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- |
V1 V = ChemID Online Databases; Chemspider; PubChem. (ChemID )
1 = Estimated data with little or no verification |
Mobile | |||||||
|
18 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
| Fate indices |
|
|
|
|
||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||||||||||||||||||||
|
- | - | |||||||||||||||||||||||||||
| Known soil and groundwater metabolites |
None
| Other known metabolites |
|
|
|
|
|
|||||
|---|---|---|---|---|---|---|---|---|---|
| centrophenoxine | - | Plant | - | - |
|
| Terrestrial ecotoxicology |
|
|
|
|
||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
850 |
C4 C = AGRITOX dataset. Dataset is no longer
available. Rat
4 = Verified data |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
| - | - | - | |||||||||
|
|
> 100 |
E3 E = Manufacturers safety data sheets
3 = Unverified data of known source |
Low | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
| - | |||||||||||
|
- | - | - | ||||||||
| - | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
| Aquatic ecotoxicology |
|
|
|
|
||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
> 180 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) Lepomis macrochirus
3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
> 40 |
Q2 Q = Miscellaneous data from online sources Daphnia magna
2 = Unverified data of unknown source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
1.4 |
Q2 Q = Miscellaneous data from online sources Unknown species
2 = Unverified data of unknown source |
Moderate | ||||||||
|
1 |
A2 A = EU regulatory and evaluation data as published by
EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU -
Pesticides database; EFSA Scientific Publications ) Unknown species
2 = Unverified data of unknown source |
Moderate | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
| General |
|
|
|
|
||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
850 |
C4 C = AGRITOX dataset. Dataset is no longer
available. Rat
4 = Verified data |
Moderate | ||||||||
|
2200 |
L3 L = Pesticide manuals and hard copy reference books /
other sources Rat
3 = Unverified data of known source |
- | ||||||||
|
10.6 |
L3 L = Pesticide manuals and hard copy reference books /
other sources Rat
3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
Exposure from air or water very low as it is usually used inside Small risk of dietary exposure Source: US EPA |
|||||||||
|
Low risk of exposure during handling Source: US EPA |
||||||||||
|
|
|
|||||||||
|
|
||||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
| Health issues |
|
|
||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Potential irritant Potential kidney toxicant |
||||||||||||||||||||||||||||
| Handling issues |
|
|
|||
|---|---|---|---|---|
|
Not expected to autoignite; Not highly flammable | |||
|
Health: H302 | |||
|
II (Moderately hazardous) | |||
|
Not regulated | |||
|
- | |||
|
- |
|
|
|
||
|---|---|---|---|
|
(4-chlorophenoxy)acetic acid | ||
|
acide 4 chlorophenoxyacetique | ||
|
4-CPA | ||
|
4-CPA | ||
|
4-CPA (acido 4-clorofenossiacetico =PCPA) | ||
|
4-CPA | ||
|
- | ||
|
4-CPA | ||
|
- | ||
|
4-CPA | ||
|
- | ||
|
- |


