| 2,4,5-trichlorophenol |
(Also known as: TCP; 2,4,5-TCP; trichlorophenol) |
| 2,4,5-trichlorophenol is a substance with fungal, herbicidal and bacterial activity. It is highly soluble in water has a low volatility and is slightly mobile in soil systems. It is moderately toxic to most biodiverrsity 2,4,5-trichlorophenol has a moderrate oral mammalian toxicity, is a neurotoxin and an irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Neurotoxicant
 |
|
|
Active substance and pesticide transformation product with fungicial and herbicidal action, used particularly for the control of broad-leaved weeds in grass |
|
|
Gorse; Brush weeds; Thistles |
|
|
- |
|
|
- |
|
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
|
circa 1945 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
|
C₆H₃Cl₃O |
|
|
C1=C(C(=CC(=C1Cl)Cl)Cl)O |
|
|
No data |
|
|
LHJGJYXLEPZJPM-UHFFFAOYSA-N |
|
|
InChI=1S/C6H3Cl3O/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H |
|
|
Yes |
|
|
Fungicide, Herbicide, Bactericide, Metabolite, Algicide, Other substance |
|
|
Soil, Plant |
|
|
Impurity |
|
|
Organochloride fungicide; Organochloride herbicide; Organochloride biocide; Phenolic compound |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Causes distorted growth that affects respiration and cell function |
|
|
95-95-4 |
|
|
202-467-8 |
|
|
6 |
|
|
064210 |
|
|
44147467 |
|
|
604-017-00-X |
|
|
197.45 |
|
|
- |
|
|
1-hydroxy-2,4,5-trichlorobenzene |
|
|
2,4,5-trichlorophenol |
|
|
POP; Chemical subject to PIC regulations |
|
|
- |
|
|
Not known |
|
|
Not known |
|
|
Not applicable |
|
|
Not known |
|
|
- |
|
|
Grey crystalline solid |
|
|
|
|
|
|
|
|
|
|
1200 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
High |
|
|
- |
- |
- |
|
|
68 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
247 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
5.25 X 1003 |
Calculated |
- |
|
|
3.72 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.68 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
7.4 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.0029 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low volatility |
|
|
0.16 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
11.3 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Turfgrass, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slightly mobile |
|
|
836 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
131 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
820 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
46 |
Eisenia andrei |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 50 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.49 |
Oncorhynchus mykiss |
Moderate |
|
|
0.0625 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
0.9 |
Daphnia magna |
Moderate |
|
|
0.375 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
3.83 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.2 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
820 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.03 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Negligible risk to bystanders |
|
|
Exposure may occur via inhalation or skin absorption |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
IARC listed carcinogen 2B May be toxic to gastrointestinal tract, skin May cause hypotension, myocardial failure and pulmonary edema |
|
|
|
|
|
Corrosive Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6.1 |
|
|
- |
|
|
Not classified: Obsolete |
|
|
UN2020 |
|
|
{Packaging Group III (minor danager) |
|
|
- |
|
|
|
|
|
2,4,5-trichlorophenol |
|
|
- |
|
|
- |
|
|
2,4,5-trichlorphenol |
|
|
- |
|
|
- |
|
|
- |
|
|
2,4,5-trichlorofenol |
|
|
- |
|
|
- |
|
|
- |
|
|
- |