| 2,3,6-TBA (Ref: HC 1281) |
(Also known as: trichlorobenzoic acid; trichlorobenzene; trichlorobenzyl chloride metabolite; T-2) |
| 2,3,6-TBA is a post-emergence herbicide. It is highly soluble in water and most organic solvents. It is considered volatile. Little has been reported on its environmental persistence or mobility. It is moderately toxic to mammals and a recognised irritant. Based on its chemical properties it would not expected to bioaccumulate. There are gaps in knowledge regarding its toxicity to biodiversity however data has shown that it is moderately toxic to bids, fish and honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate
 Warning: Significant data are missing |
|
|
A post-emergence herbicide used to control annual and perennial broad-leaved weeds |
|
|
Woody weeds including root suckers; Honeysuckle; hemlock; Canada thistle; Adler; Sycamore; Trumpet vine; |
|
|
Cereals including wheat, barley, oats, field corn; Grass seed crops; Non-crop areas including railroads, rights of way, utility areas |
|
|
- |
|
|
Current |
|
|
1952, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₇H₃Cl₃O₂ |
|
|
C1=CC(=C(C(=C1Cl)C(=O)O)Cl)Cl |
|
|
No data |
|
|
XZIDTOHMJBOSOX-UHFFFAOYSA-N |
|
|
InChI=1S/C7H3Cl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) |
|
|
Yes |
|
|
Herbicide |
|
|
Benzoic acid herbicide |
|
|
>97% |
|
|
- |
|
|
Synthetic |
|
|
Systemic, absorbed by leaves and roots with auxin type action |
|
|
50-31-7 |
|
|
200-026-4 |
|
|
49 |
|
|
- |
|
|
5759 |
|
|
607-152-00-2 |
|
|
225.45 |
|
|
- |
|
|
2,3,6-trichlorobenzoic acid |
|
|
2,3,6-trichlorobenzoic acid |
|
|
- |
|
|
- |
|
|
O |
|
|
4 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as an aqueous solution |
|
|
|
|
|
|
|
7700 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
607000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 238000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 237000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
| 637000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
|
|
125 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
Decomposes on distillation |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
5.13 X 1002 |
Calculated |
- |
|
|
2.71 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.687 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
| Strong acid |
|
|
73.32 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Highly volatile |
|
|
2.15 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source |
Mobile |
|
|
65 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
40 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1500 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2000 |
Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
8.5 |
Pimephales promelas |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 1500 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
14.0 |
AC3 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Potentially via inhalation or dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Over exposure may cause nausea, salivation, tremor and depression |
|
|
|
|
|
Not compatible with fertilisers |
|
|
Health: H302 Environment: H411 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
2,3,6-TBA |
|
|
- |