| 2-(thiocyanomethylthio)benzothiazole |
(Also known as: TCMTB; TCMB; alentisan; KVK 733059) |
| 2-(thiocyanomethylthio)benzothiazole is a a soil and seed treatment used to control various fungal and bacterial infections. It is moderately soluble in water, has a low volatility and is not expected to be persistent in soil systems. It is not eexpected to leach to groundwater. It has a pungent odour, is highly toxic to most aquatic species and moderately toxic to birds. 2-(thiocyanomethylthio)benzothiazole is highly toxic to humans via the oral route and is a recognised irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen
 |
|
|
Used as a soil and seed treatment against various diseases. Also used as a marine biocide, and as a wood and leather preservative. |
|
|
Mildews; Moulds; Bacterial blight; Bacterial slime; Basal rot; Brown rot; Damping off; Kernal smut; Bunt |
|
|
Cereals including barley, wheat, oats; Ornamentals; Cotton, Rice; Legumes; Sorghum; Sugar beet |
|
|
- |
|
|
Current |
|
|
1980, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₉H₆N₂S₃ |
|
|
C1=CC=C2C(=C1)N=C(S2)SCSC#N |
|
|
- |
|
|
TUBQDCKAWGHZPF-UHFFFAOYSA-N |
|
|
InChI=1S/C9H6N2S3/c10-5-12-6-13-9-11-7-3-1-2-4-8(7)14-9/h1-4H,6H2 |
|
|
Yes |
|
|
Fungicide, Microbiocide, Other substance |
|
|
Wood preservative |
|
|
Mercaptobenzothiazole fungicide; Mercaptobenzothiazole biocide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Complex - reacts with the nucleophilic cell entities which causes the antimicrobial activity. Also known to inhibit flavoenzymes in the tricarboxylic acid cycle. |
|
|
21564-17-0 |
|
|
244-445-0 |
|
|
None allocated |
|
|
035603 |
|
|
30692 |
|
|
613-119-00-3 |
|
|
238.36 |
|
|
- |
|
|
2-(thiocyanatomethylthio)-1,3-benzothiazole |
|
|
(2-benzothiazolylthio)methyl thiocyanate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
- |
|
|
Dark orange liquid |
|
|
|
|
|
- |
|
|
- Busan 30
- Busan 44
- Superdavloxan
|
|
|
Usually supplied as an emulsifiable liquid, ready-to-use liquids and wettable powders |
|
|
|
|
|
|
|
125 |
V4 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 4 = Verified data at 24 °C |
Moderate |
|
|
Miscible |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethanol |
- |
| Miscible |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethyl acetate |
- |
|
|
- |
- |
- |
|
|
191 |
|
- |
|
|
60 |
- |
- |
|
|
189 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
2.00 X 1003 |
Calculated |
- |
|
|
3.3 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.4 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
6.58 X 10-07 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.4 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
|
- |
|
|
Stable at pH 5, slow hydrolysis at pH 7, around 2 days at pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-mobile |
|
|
4089 |
|
|
Koc range 282 - 7896 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.06 |
Calculated |
Low leachability |
|
|
|
2.07 X 10-04 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
230 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Whole fish |
Threshold for concern |
|
|
Not available |
- |
|
|
|
|
|
|
|
Minor fraction |
- |
- |
|
|
Minor fraction |
- |
- |
| Known groundwater metabolites |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
143 |
V4 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 4 = Verified data Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 1310 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.0021 |
Oncorhynchus mykiss |
High |
|
|
0.00034 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Oncorhynchus mykiss 60 day |
High |
|
|
0.0153 |
Ceriodaphnia dubia |
High |
|
|
0.00089 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.43 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
143 |
V4 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 4 = Verified data Rat |
Moderate |
|
|
10000 |
Rabbit |
- |
|
|
0.0671 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Can be absorbed into the body by inhalation of its aerosol and by ingestion |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Probably liver and kidney toxicant May damage eyes |
|
|
|
|
|
Corrosive Combustable |
|
|
Health: H302, H315, H319, H330 EnvironmentL H400, H410 |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
2-(thiocyanomethylthio)benzothiazole |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |