| 1,2-dichloropropane (Ref: ENT 15406 ) |
(Also known as: propylene dichloride; 1,2-DCP; dichloro-1,2-propane; dichloropropane; PDC) |
| Dichlorpropane is a multi-use substance with insecticidal and fungicidal activity. It is considered obsolete but may be used in some countries. It is a volatile organic compound (VOC) which is highly soluble in water. It can be very persistent in soil systems depending on environmental conditions and it also has poitenrtial to leach to groundwater. 1,2-dichloropropane tends to have a moderate to low toxicity to biodiversity but there are considerable gaps in data. It is moderately toxic to mammals via the oral route and there are concerns regarding its potential to cause reproduction/developmental effects in humans. It is also a recognised irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate
 |
Human health High alert: Endocrine distrupter; Reproduction/development effects
 |
|
|
Chemical with a range of agricultural applications including uses a soil fumigant to control nematodes and as an insecticide for stored grain. |
|
|
Nematodes; Flour beetles; Grain beetles |
|
|
Agricultural crops; Stored grain |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1925, first reported |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Dichloropropane has four isomers (1,1-, 1,2, 1,3- and 1,4-1,2-dichloropropane). 1,2-dichloropropane tends to be the main one used in the agricultrual context and is itself chiral.existing in two enantiomeric forms (S- and R-) |
|
|
C₃H₆Cl₂ |
|
|
CC(CCl)Cl |
|
|
No data |
|
|
KNKRKFALVUDBJE-UHFFFAOYSA-N |
|
|
InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3 |
|
|
Yes |
|
|
Insecticide, Nematicide, Fumigant, Other substance |
|
|
Solvent, Chemical intermediate |
|
|
Organochloride insecticide; Fumigant insecticide; Fumigant nematicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Unknown |
|
|
78-87-5 |
|
|
201-152-2 |
|
|
674 |
|
|
029002 |
|
|
6564 |
|
|
602-020-00-0 |
|
|
112.99 |
|
|
rac-(2R)-1,2-dichloropropane |
|
|
1,2-dichloropropane |
|
|
1,2-dichloropropane |
|
|
VOC |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
2A |
|
|
Not applicable |
|
|
- |
|
|
Colourless liquid |
|
|
|
|
|
|
|
2700 |
|
High |
|
|
Miscible |
Acetone |
- |
| Miscible |
Methanol |
- |
|
|
-70.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Freezing point |
- |
|
|
95.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.05 X 1002 |
Calculated |
- |
|
|
2.02 |
AC3 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 3 = Unverified data of known source |
Low |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.18 |
AC3 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
1.94 X 1006 |
AC3 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 3 = Unverified data of known source |
Highly volatile |
|
|
285.74 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
700 |
|
Very persistent |
|
|
140 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature states chemical is persistent with DT₅₀ longer than 7 wks. Other sources: 700 days (US3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
18.5 |
AC3 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 3 = Unverified data of known source |
Slow |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
Resistant to hydrolysis DT₅₀ 175-1400 days. |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Mobile |
|
|
50 |
|
|
Other data sources Koc range 46-51 mL g⁻¹ (USDA) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
4.94 |
Calculated |
High leachability |
|
|
|
4.42 X 1000 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1947 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
4240 |
AC3 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
280 |
Lepomis macrochirus |
Low |
|
|
- |
- |
- |
|
|
23.5 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
24.8 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
50.0 |
Chlamydomonas reinhardtii |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1947 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Rat |
Moderate |
|
|
1100 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Rat |
- |
|
|
14.0 |
AC3 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
List I |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
Non-statutory WHO drinking water guideline 0.04 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Liver, blood, kidney and lung toxicant Strong narcotic |
|
|
|
|
|
Flammable, explosive when mixed with air Corrosive Toxic and irritating gases may be generated in a fire IMDG Transport Hazard Class 3 |
|
|
- |
|
|
FM (Fumigant, not classified) |
|
|
UN1279 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
1,2-dichloropropane |
|
|
1,2-dichloropropane |
|
|
1,2-Dichlorpropan |
|
|
1,2-dichloropropane |
|
|
- |
|
|
1,2-dicloropropano |
|
|
- |
|
|
dwuchloropropan |
|
|
- |
|
|
- |
|
|
- |
|
|
- |